Write the IUPAC name of CH3-CH(C2H5)-C...

Write the IUPAC name of
`CH_3-CH(C_2H_5)-CH(CH_3)-CH(CH_3)_2`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of CH_3-CH(C_2H_5)-CH(CH_3)-CH_2-CH=CH_2

Write the IUPAC name of CH_3-CH(C_2H_5)-CH(C_2H_5)-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH(CH_3)-CH(CH_3)_2

Write the IUPAC name of CH_3-CH(CH_3)-C(CH_3)_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH(C_6H_5)-CH_3

Write the IUPAC name of CH_3-C(CH_3)_2-C(CH_3)_2-CH_3

Write the IUPAC name of CH_3-CH=C(CH_3)_2

Write the IUPAC name of CH_3-N(C_6H_5)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(CH_2-CH_3)-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH(CH_3)-CH(C_2H_5)-CH_3

Recommended Questions

Write the IUPAC name of CH3-CH(C2H5)-CH(CH3)-CH(CH3)2
Text Solution
|
The IUPAC name of the compound CH3-CH(C2H5)-CH=CH-CH3 is
Text Solution
|
यौगिकों के IUPAC नाम लिखिए - एल्काइल हैलाइड (Alkyl Halides) संरचना स...
Text Solution
|
The IUPAC name of (CH3)2CH-CH=CH-CH=Chunderset(C2H5)underset(|)-CH-CH3...
Text Solution
|
(CH3)2CH-CH(CH3)2 का IUPAC नाम है
Text Solution
|
(CH3)2C(Br)CH(Cl)CH(CH2CH3)CH3 का IUPAC में नाम दीजिये ?
Text Solution
|
निम्न यौगिक का IUPAC नाम है {:(CH3-CH-CH2CH2CH3),(" "|),(" ...
Text Solution
|
नीचे दिये गये यौगिक का IUPAC नाम है (CH3)2 CH - CH2 CH = CH - CH = ...
Text Solution
|
The correct IUPAC name of CH3 - CH2 - CH (CH3) - CH (C2H5)2 is
Text Solution
|