Write the IUPAC name of CH3-CH(Br)-CH2...

Write the IUPAC name of
`CH_3-CH(Br)-CH_2-CH_2-C(Cl)_2-CH_3`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of CH_3-CH(Cl)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(Cl)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(Cl)-CH_2-CH_3

Write the IUPAC name of CH_3-C(Br)(CH_2-CH_2-CH_3)-CH_2-CH_3

Write the IUPAC name of (CH_3)_2C(Br)CH_2-CH_3

Write the IUPAC name of CH_3-CH(Cl)-CH=CH_2

Write the IUPAC name of CH_3-CH_2-CH(Br)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-C(Br)_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CH_2-C-=C-CH_2-CH_3

Recommended Questions

Write the IUPAC name of CH3-CH(Br)-CH2-CH2-C(Cl)2-CH3
Text Solution
|
The IUPAC name of compound CH3-C(CH3)2-CH2-CH=CH2 is
Text Solution
|
Write IUPAC names of the {:(CH3(CH2)CH(CH2)CH3),(" "|),(" "CH2-CH(CH3)...
Text Solution
|
निम्न संरचनाओं के IUPAC नाम लिखिए- (8) CH3-CH2-CH2-overset(CI-overset(...
Text Solution
|
निम्न संरचनाओं के IUPAC नाम लिखिए -(9) CH3-CH2-CH2-overset(CI-CH-CH2-B...
Text Solution
|
निम्नलिखित यौगिकों के IUPAC नाम लिखिए - (अ) CH3-CH2-CH2-Br ( ब) CH2=...
Text Solution
|
IUPAC name of (CH3)2 CHCH2CH2Br is
Text Solution
|
The correct IUPAC name of the following structure is: - {:(" "CH2-CH3)...
Text Solution
|
Br - CH2 (CH2)2 - overset(CH3)overset(|)CH-Br + CH3NH2 to
Text Solution
|