Write the IUPAC name of CH3-CH2-C(CH3)...

Write the IUPAC name of
`CH_3-CH_2-C(CH_3)(CH_2-CH_2-CH_3)-CH(C_2H_5)_2`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of CH_3-CH_2-C(CH_3)(CH_2-CH_2-CH_3)-CH(C_2H_5)-C_2H_5

Write the IUPAC name of CH_3-CH_2-C(CH_3)_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-C(CH_3)_2-CH_2-I

Write the IUPAC name of CH_3-CH_2-C(CH_3)=CH-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-C(OH)(CH_2-CH_2-CH_3)-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-C(CH_3)(OH)-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH(CH_3)-CH(C_2H_5)-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-C(CH_3)_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-C-=C-CH_2-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH(CH_2-CH_2)-CH_3

Recommended Questions

Write the IUPAC name of CH3-CH2-C(CH3)(CH2-CH2-CH3)-CH(C2H5)2
Text Solution
|
The IUPAC name of compound CH3-C(CH3)2-CH2-CH=CH2 is
Text Solution
|
{:(CH3-CH2-,CH-CH2-,CH-CH2-CH2-CH3),(,"|","|"),(,CH3,CH2-CH3):} का IUP...
Text Solution
|
The IUPAC name of {:(CH2=CH-CH-CH2-CH3),(" "|)...
Text Solution
|
The IUPAC name of {:(" "CH2CH3" "CH3),(" ...
Text Solution
|
Write IUPAC names of the following compounds: {:(CH3(CH2)4underset(...
Text Solution
|
Write IUPAC names of the {:(CH3(CH2)CH(CH2)CH3),(" "|),(" "CH2-CH(CH3)...
Text Solution
|
निम्नलिखित यौगिकों के IUPAC नाम लिखिए - (अ) CH3-CH2-CH2-Br ( ब) CH2=...
Text Solution
|
Correct IUPAC name of {:(" "CH3),(" "|),(CH3-CH2-C=CH-CH-CH2-CH3),(" "...
Text Solution
|