Write the IUPAC name of CH3-CH(C2H5)-C...

Write the IUPAC name of
`CH_3-CH(C_2H_5)-CH(CH_3)-CH_2-CH=CH_2`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of CH_3-CH(C_2H_5)-CH(C_2H_5)-CH_3

Write the IUPAC name of CH_3-CH(C_2H_5)-CH(CH_3)-CH(CH_3)_2

Write the IUPAC name of CH_3-CH(CH_3)-C(CH_3)_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH(C_6H_5)-CH_3

Write the IUPAC name of CH_3-CH_2-CH(CHO)-CH(CH_3)-CH_2-CH_3

Write the IUPAC name of CH_3-N(C_6H_5)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(CH_2-CH_3)-CH_2-CH_3

Write the IUPAC name of CH_3-C(CH_3)_2-C(CH_3)_2-CH_3

Write the IUPAC name of CH_3-CH=C(CH_3)_2

Write the IUPAC name of CH_3-CH_2-CH(CH_3)-CH(C_2H_5)-CH_3

Recommended Questions

Write the IUPAC name of CH3-CH(C2H5)-CH(CH3)-CH2-CH=CH2
Text Solution
|
{:(CH3-CH2-,CH-CH2-,CH-CH2-CH2-CH3),(,"|","|"),(,CH3,CH2-CH3):} का IUP...
Text Solution
|
{:(" "CH2-CH3),(" ...
Text Solution
|
What will be the IUPAC name of given compound? {:(" ...
Text Solution
|
The IUPAC name of {:(CH2=CH-CH-CH2-CH3),(" "|)...
Text Solution
|
Write IUPAC names of the {:(CH3(CH2)CH(CH2)CH3),(" "|),(" "CH2-CH(CH3)...
Text Solution
|
निम्न संरचनाओं के IUPAC नाम लिखिए -(9) CH3-CH2-CH2-overset(CI-CH-CH2-B...
Text Solution
|
निम्न का IUPAC नाम है {:(CH3-CH-CH2-CH(OH)-CH3),(" "|),(" ...
Text Solution
|
CH3-CH(C2H5)-CH2-Br The correct IUPAC name of the compound -
Text Solution
|