Write the IUPAC name of CH3-CH(COOH)-C...

Write the IUPAC name of
`CH_3-CH(COOH)-CH_2-CH(COOH)-CH_3`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of CH_3-CH(COOH)-CH_2-CH_3

Write the IUPAC name of CH_3-CH-(CH_3)-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CH(CH_3)_2

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CH(CH_3)_3

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CH(CH_3)-CH(CH_3)-CH_2-CH_3

Write the IUPAC name of CH_(3)CH_(2)COOH

Write the IUPAC name of CH_(3)CH_(2)COOH

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH_2-COOH

Write the IUPAC name of CH_3-CH(CH_3)-C(CH_3)_2-CH_2-CH_3

Recommended Questions

Write the IUPAC name of CH3-CH(COOH)-CH2-CH(COOH)-CH3
Text Solution
|
CH3-CH2-oversetoverset(CH3)|CH-COOH का IUPAC नाम लिखिए ।
Text Solution
|
यौगिकों के IUPAC नाम लिखिए - विविध उदाहरण संरचना सूत्र (IUPAC नाम)...
Text Solution
|
CH3-CH=CH-COOH का IUPAC नाम है :
Text Solution
|
यौगिक CH3-oversetoverset(OH)|CH-CH2-COOH का IUPAC नाम लिखिए ।
Text Solution
|
Name the compound in the IUPAC method HOOC-CH2 CH(CH3)COOH
Text Solution
|
Write the IUPAC names of the following. CH3-CH-CH2-CH2-CH2-COOH
Text Solution
|
Write the IUPAC name [CH3 - CH2 - CH = CH- CH2 - COOH]
Text Solution
|
Write the IUPAC name for the following Compounds :- CH3-CH(NO2)- CH2-C...
Text Solution
|