Which compound would give 5-keto-2-methylhexanal on ozonolysis ?

Options

A.
B.
C.
D.

Explanation

To determine which compound would give 5-keto-2-methylhexanal on ozonolysis, we need to analyze the structure of the target compound and understand the ozonolysis reaction.

### Step 1: Understand the structure of 5-keto-2-methylhexanal
5-keto-2-methylhexanal has the following characteristics:
- It is an aldehyde (due to the presence of the -CHO group).
- The carbon chain consists of 6 carbon atoms (hexanal).
- There is a ketone group (C=O) at the 5th carbon.
- There is a methyl group (-CH3) at the 2nd carbon.

### Step 2: Identify the structure of the compound that would yield this product
To produce 5-keto-2-methylhexanal via ozonolysis, we need to consider a compound that, upon cleavage of its double bond, would generate the required aldehyde and ketone.

A suitable candidate would be a compound that has a double bond between the 2nd and 3rd carbon atoms of a 6-carbon chain.

### Step 3: Propose a compound
The compound that fits this description is 2-methyl-2-hexene. Its structure can be represented as follows:
- The double bond is between the 2nd and 3rd carbon atoms.
- The structure is as follows:
- CH3-CH=C(CH3)-CH2-CH2-CHO

### Step 4: Predict the ozonolysis products
When 2-methyl-2-hexene undergoes ozonolysis, the double bond will break, and oxygen will be added to both ends of the broken double bond. This will lead to the formation of:
- A ketone at the 5th carbon (5-keto).
- An aldehyde at the terminal carbon (2-methylhexanal).

### Conclusion
Thus, the compound that would give 5-keto-2-methylhexanal on ozonolysis is **2-methyl-2-hexene**.

---