Home
Class 10
CHEMISTRY
The first member of alkyne homologous se...

The first member of alkyne homologous series is

A

ethyne

B

ethene

C

propyne

D

methane

Text Solution

AI Generated Solution

The correct Answer is:
To find the first member of the alkyne homologous series, we can follow these steps: ### Step 1: Understand the General Formula The general formula for alkynes is given as: \[ \text{C}_n\text{H}_{2n-2} \] where \( n \) represents the number of carbon atoms. ### Step 2: Determine the Value of n for the First Member For the first member of the alkyne series, we set \( n = 2 \): \[ n = 2 \] ### Step 3: Substitute n into the General Formula Now, we substitute \( n \) into the general formula: \[ \text{C}_2\text{H}_{2(2)-2} = \text{C}_2\text{H}_2 \] ### Step 4: Identify the Compound The compound with the formula \( \text{C}_2\text{H}_2 \) is known as ethyne. It can also be represented structurally as: \[ \text{C} \equiv \text{C} \] This indicates a triple bond between the two carbon atoms. ### Step 5: Conclusion Thus, the first member of the alkyne homologous series is ethyne. ### Final Answer The first member of the alkyne homologous series is **ethyne (C2H2)**. ---

To find the first member of the alkyne homologous series, we can follow these steps: ### Step 1: Understand the General Formula The general formula for alkynes is given as: \[ \text{C}_n\text{H}_{2n-2} \] where \( n \) represents the number of carbon atoms. ### Step 2: Determine the Value of n for the First Member ...
Promotional Banner

Topper's Solved these Questions

  • ACIDS, BASES AND SALTS

    NCERT EXEMPLAR|Exercise Acids, Bases And Salts|27 Videos
  • CHEMICAL REACTIONS AND EQUATIONS

    NCERT EXEMPLAR|Exercise Long Answer Type Questions|1 Videos

Similar Questions

Explore conceptually related problems

______ is the first member of the homologous series of alkynes.

Acetone is the first member of the homologous series of ketone, whereas pentan-2-one is _________ member of the homologous series of ketone.

Members of a homologous series have

The different members of a homologous series possess

Write the molecular formulae of the first two members of the homologous series having functional group, -COOH.

Write the molecular formula of the first two members of the homologous series having functional group gtC=O .

NCERT EXEMPLAR-CARBON AND ITS COMPOUNDS-Carbon And Its Compounds
  1. The heteroatoms present in CH(3)-CH(2)-O-CH(2)-CH(2)Cl (i) oxygen,...

    Text Solution

    |

  2. Which of the following represents saponification reaction ?

    Text Solution

    |

  3. The first member of alkyne homologous series is

    Text Solution

    |

  4. Draw the electron dot structure of ethyne and also draw its structure ...

    Text Solution

    |

  5. Write the names of the following compounds. (a) H-underset(H)unders...

    Text Solution

    |

  6. Identify and name the functional groups present in the following compo...

    Text Solution

    |

  7. A compounds X is fromed by the reaction of a carboxylic acid C(2)H(4)O...

    Text Solution

    |

  8. Why detergents are better cleansing agents than soaps ? Explain.

    Text Solution

    |

  9. Name the functional groups present in the following compounds. (a) ...

    Text Solution

    |

  10. How is ethene prepared from ethanol ? Give the reaction involved in it...

    Text Solution

    |

  11. Intake of small quantity of methanol can be lethal. Comment.

    Text Solution

    |

  12. A gas is evolved when ethanol reacts with sodium. Name the gas evolved...

    Text Solution

    |

  13. Ethene is formed when ethanol at 443 K is heated with excess of concen...

    Text Solution

    |

  14. Carbon, group (14) element in the periodic table, is know to from comp...

    Text Solution

    |

  15. In electron dot structure, The valence shell electrons are represented...

    Text Solution

    |

  16. Catenation is the ability of an atom to form bonds with other atoms of...

    Text Solution

    |

  17. Unsaturated hydrocarbons contain multiple bonds between the two C-atom...

    Text Solution

    |

  18. Match the reactions given in Column I with the names given in Column I...

    Text Solution

    |

  19. Write the structural formulae of all isomers of hexane.

    Text Solution

    |

  20. What is the role of metal or reagents written on arrows in the given c...

    Text Solution

    |