Home
Class 11
CHEMISTRY
In the reaction CH(3)CHO+CH(3)COCH(3)wit...

In the reaction `CH_(3)CHO+CH_(3)COCH_(3)`with base , how many distinct aldol products are possible ?

A

1

B

2

C

3

D

4

Text Solution

AI Generated Solution

The correct Answer is:
To determine how many distinct aldol products can be formed from the reaction of acetaldehyde (CH₃CHO) and acetone (CH₃COCH₃) in the presence of a base, we will follow these steps: ### Step 1: Identify the Reactants The reactants are: - Acetaldehyde (CH₃CHO) - Acetone (CH₃COCH₃) ### Step 2: Understand the Aldol Reaction In an aldol reaction, one of the carbonyl compounds (aldehyde or ketone) undergoes deprotonation at the alpha carbon by a base, forming an enolate ion. This enolate can then attack the carbonyl carbon of another molecule, leading to the formation of a β-hydroxy carbonyl compound (aldol). ### Step 3: Determine the Alpha Hydrogens - Acetaldehyde has 3 alpha hydrogens (from CH₃). - Acetone has 6 alpha hydrogens (from CH₃ groups). ### Step 4: Form Enolate Ions 1. **Enolate from Acetaldehyde**: The base abstracts one alpha hydrogen from acetaldehyde, forming an enolate. 2. **Enolate from Acetone**: The base abstracts one alpha hydrogen from acetone, forming an enolate. ### Step 5: Possible Aldol Products 1. **Acetaldehyde Enolate + Acetaldehyde**: - This can lead to one aldol product. 2. **Acetaldehyde Enolate + Acetone**: - This can lead to another distinct aldol product. 3. **Acetone Enolate + Acetone**: - This can lead to a third aldol product. 4. **Acetone Enolate + Acetaldehyde**: - This can lead to a fourth distinct aldol product. ### Step 6: Count Distinct Products From the above combinations, we can summarize the distinct aldol products: 1. From acetaldehyde enolate + acetaldehyde 2. From acetaldehyde enolate + acetone 3. From acetone enolate + acetone 4. From acetone enolate + acetaldehyde ### Conclusion Thus, there are **four distinct aldol products** possible from the reaction of acetaldehyde and acetone in the presence of a base. ### Final Answer **4 distinct aldol products are possible.** ---

To determine how many distinct aldol products can be formed from the reaction of acetaldehyde (CH₃CHO) and acetone (CH₃COCH₃) in the presence of a base, we will follow these steps: ### Step 1: Identify the Reactants The reactants are: - Acetaldehyde (CH₃CHO) - Acetone (CH₃COCH₃) ### Step 2: Understand the Aldol Reaction ...
Promotional Banner

Topper's Solved these Questions

  • CARBONYL COMPOUNDS

    NARAYNA|Exercise LEVEL -VI|99 Videos
  • CARBONYL COMPOUNDS

    NARAYNA|Exercise LEVEL -II (H.W)|20 Videos
  • BENZENE

    NARAYNA|Exercise Level-6|121 Videos
  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    NARAYNA|Exercise EXERCISE -4|54 Videos

Similar Questions

Explore conceptually related problems

IUPAC name of CH_(3)CH_(2)CH_(2)COCH_(3) is

In the compound CH_(3)CH_(2)COCH_(3) , the number of hydrogen atoms taking part in aldol condensation is :

In the reaction C_(6)H_(5)CHO+(CH_(3)CO)_(2)Ooverset(CH_(3)COONa)rarrA . Product A is

The IUPAC name of CH_(3)CH_(2)CH_(2)CH(CH_(3))COCH_(3) is

For a reaction, r=k(CH_(3)COCH_(3))_(^(3//2) then unit of rate of reaction and rete constant respectively is

CH_(3)COCH_(3) and CH_(3)CH_(2)CHO can be distinguished by :

NARAYNA-CARBONYL COMPOUNDS-LEVEL-V
  1. In a Cannizaro reaction the intermediate that will be the best hydride...

    Text Solution

    |

  2. Products is

    Text Solution

    |

  3. In the reaction CH(3)CHO+CH(3)COCH(3)with base , how many distinct ald...

    Text Solution

    |

  4. The product obtained by reaction of PhCHO & MeCHO in basic medium are ...

    Text Solution

    |

  5. CH(3)CHO+NH(2)OHto CH(3)CH=N-OH The above reaction is carried out at

    Text Solution

    |

  6. The product A and B in the reaction given below are :

    Text Solution

    |

  7. is the final product obtained when one of the following reacted with b...

    Text Solution

    |

  8. End product of the following sequence of reaction is CH-=CHoverset(C...

    Text Solution

    |

  9. Which of the following are examples of aldol condensation ? 1.2CH...

    Text Solution

    |

  10. Match list I (reaction) with list II (Reagent) and select the correct ...

    Text Solution

    |

  11. Mononitration of phenyl benzoate gives the major product :

    Text Solution

    |

  12. Identify the final product

    Text Solution

    |

  13. In the reaction overset(NaOH//200^(@) C)to overset(H^(oplus...

    Text Solution

    |

  14. Identify the product (B)

    Text Solution

    |

  15. Which of the following reagent on reaction with conc. NaOh followed by...

    Text Solution

    |

  16. Text Solution

    |

  17. A+B Compound (A) and (B) can be differentiated by :

    Text Solution

    |

  18. Above compounds can be differentiated by following reagent :

    Text Solution

    |

  19. Rank the following in order of increasing value of the equilidrium con...

    Text Solution

    |

  20. Ph-overset(O)overset(||)(C)-CH(3) overset(NaNO(2))underset(HCl)(to) (A...

    Text Solution

    |