Home
Class 11
CHEMISTRY
If a reaction vessel at 400^(@)C is char...

If a reaction vessel at `400^(@)C` is charged with equimolar mixture of `CO` and steam such that `P_(CO)=P_(H_(2))O=4` bar what will be that partial pressure of `H_(2)` at equilibrium
`CO_(if)+H_(2)OhArrCO_(2)+H_(2)K_(P=9`

A

`0.3` bar

B

`0.4` bar

C

`0.2` bar

D

`0.1` bar

Text Solution

AI Generated Solution

The correct Answer is:
To solve the problem, we will follow these steps: ### Step 1: Write the balanced chemical equation The reaction given is: \[ \text{CO} + \text{H}_2\text{O} \rightleftharpoons \text{CO}_2 + \text{H}_2 \] ### Step 2: Define initial conditions We are given that the partial pressures of CO and H2O are both 4 bar at the start: - \( P_{\text{CO}} = 4 \, \text{bar} \) - \( P_{\text{H}_2\text{O}} = 4 \, \text{bar} \) ### Step 3: Set up the equilibrium expression The equilibrium constant \( K_p \) is given as 9. The expression for \( K_p \) for the reaction is: \[ K_p = \frac{P_{\text{CO}_2} \cdot P_{\text{H}_2}}{P_{\text{CO}} \cdot P_{\text{H}_2\text{O}}} \] ### Step 4: Define changes in partial pressures Let \( x \) be the change in pressure of CO and H2O that reacts to reach equilibrium. The changes in partial pressures will be: - At equilibrium: - \( P_{\text{CO}} = 4 - x \) - \( P_{\text{H}_2\text{O}} = 4 - x \) - \( P_{\text{CO}_2} = x \) - \( P_{\text{H}_2} = x \) ### Step 5: Substitute into the equilibrium expression Substituting the equilibrium pressures into the \( K_p \) expression: \[ K_p = \frac{x \cdot x}{(4 - x)(4 - x)} = \frac{x^2}{(4 - x)^2} \] ### Step 6: Set the equation equal to \( K_p \) Set the equation equal to the given \( K_p \): \[ \frac{x^2}{(4 - x)^2} = 9 \] ### Step 7: Solve for \( x \) Cross-multiplying gives: \[ x^2 = 9(4 - x)^2 \] Expanding the right side: \[ x^2 = 9(16 - 8x + x^2) \] \[ x^2 = 144 - 72x + 9x^2 \] Rearranging gives: \[ 0 = 8x^2 - 72x + 144 \] Dividing the entire equation by 8: \[ 0 = x^2 - 9x + 18 \] ### Step 8: Factor or use the quadratic formula Factoring gives: \[ (x - 6)(x - 3) = 0 \] Thus, \( x = 6 \) or \( x = 3 \). Since \( x \) must be less than 4 (the initial pressures), we take \( x = 3 \). ### Step 9: Calculate the partial pressure of \( H_2 \) at equilibrium At equilibrium, the partial pressure of \( H_2 \) is: \[ P_{\text{H}_2} = x = 3 \, \text{bar} \] ### Final Answer The partial pressure of \( H_2 \) at equilibrium is **3 bar**. ---

To solve the problem, we will follow these steps: ### Step 1: Write the balanced chemical equation The reaction given is: \[ \text{CO} + \text{H}_2\text{O} \rightleftharpoons \text{CO}_2 + \text{H}_2 \] ### Step 2: Define initial conditions We are given that the partial pressures of CO and H2O are both 4 bar at the start: ...
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    RESONANCE|Exercise Advanced Level Problems (Part-2)(Section-1)|7 Videos
  • CHEMICAL EQUILIBRIUM

    RESONANCE|Exercise Advanced Level Problems (Part-2)(Section-2)|7 Videos
  • CHEMICAL EQUILIBRIUM

    RESONANCE|Exercise Exercise-3 (Part-2)|17 Videos
  • CHEMICAL BONDING

    RESONANCE|Exercise Inorganic chemistry (Chemistry Bonding)|49 Videos
  • D & F-BLOCK ELEMENTS & THEIR IMPORTANT COMPOUNDS

    RESONANCE|Exercise Match the column|1 Videos

Similar Questions

Explore conceptually related problems

Dihydrogen gas used in Haber's process is produced by reacting methane from natural gas with high temperature steam. The first stage of the two 2 stage reaction involves the formation of CO and H_(2) . In second stage, CO formed in first stage is reacted with more steam in water gas shift reaction, CO(g)+H_(2)O(g) hArr CO_(2)(g)+H_(2)(g) If a reaction vessel at 400^(@)C is charged with an equimolar mixture of CO and steam such that p_(CO)=p_(H_(2)O)=4.0 bar, what will be the partial pressure of H_(2) at equilibrium? K_(p)=10.1 at 400^(@)C .

The K_(p) value for the reaction. H_(2) +I_(2) hArr 2Hi at 460^(@)C is 49. If the initial pressure of H_(2) " and " I_(2) is 0.5 atm respectively , what will be the partial pressure of H_(2) at equilibrium ?

In a reaction, H_(2)O +C rarr CO +H_(2)

A mixture of 4 moles H_(2)O and 1 mole CO is allowed to react to come to an equilibrium. The equilibrium pressure is 2.0 atm. Calculate partial pressure (in atm) of CO(g) at equilibrium. H_(2)O (g) + CO(g) harr CO_(2) (g) + H_(2) (g); K_(C) =0.5 Use sqrt(41) = 6.4

RESONANCE-CHEMICAL EQUILIBRIUM-Advanced Level Problems (Part-1)
  1. The K(c) for H(2(g)) + I(2(g))hArr2HI(g) is 64. If the volume of the c...

    Text Solution

    |

  2. In equilibrium CH(3)COOH+H(2)OhArrCH(3)COO^(-)+H(3)O^(+) The equilib...

    Text Solution

    |

  3. CH(3)COOH(l)+CH(2)H(5)OH(l)hArrCH(3)COOC(2)O(l) In the above reaction,...

    Text Solution

    |

  4. In the following reaction started only with A(B), 2A(B)(g) hArr3A(2)(g...

    Text Solution

    |

  5. Ina 0.25 litre dissociation of 4 moles of NO takes place. If its degre...

    Text Solution

    |

  6. For the given reaction at constant pressure, {:(,nA(g)hArr,An(g)),("...

    Text Solution

    |

  7. On decomposition of NH(4)HS , the following equilibrium is estabilishe...

    Text Solution

    |

  8. At room temperature, the equilibrium constant for the reaction P + Q h...

    Text Solution

    |

  9. Calculate DeltaG^(Theta) for the conversion of oxygen to ozone, ((3)/(...

    Text Solution

    |

  10. For the reaction, 4NH(3)(g) + 5O(2)(g)hArr4NO(g) + 6 H(2)O(l), Delt...

    Text Solution

    |

  11. The effect of adding krypton (Kr) gas on position of equilibrium, keep...

    Text Solution

    |

  12. Le-Chatelier's principle is applicable only to a

    Text Solution

    |

  13. Two solid compounds X and Y dissociates at a certain temperature as fo...

    Text Solution

    |

  14. The value of DeltaG^(@)for the phosphorylation of glucose in glycolysi...

    Text Solution

    |

  15. Which of the following statements is correct for a reversible process ...

    Text Solution

    |

  16. For the following isomerisation reaction cis-butene-2hArrtrans-buten...

    Text Solution

    |

  17. In the reaction PCl(5)(g)hArrPCi(3)(g)+Ci(2)(g) a graph in plotted...

    Text Solution

    |

  18. For the reaction: PCl(5)(g)hArrPCl(3)(g)+Cl(2)(g) The forward reacti...

    Text Solution

    |

  19. Find out InK(eq) for the formation of NO(2) from NO and O(2) at 298 K ...

    Text Solution

    |

  20. If a reaction vessel at 400^(@)C is charged with equimolar mixture of ...

    Text Solution

    |