Home
Class 12
CHEMISTRY
The maximum number of electrons that can...

The maximum number of electrons that can exists in the orbital for which n = 3., 1 = 1 and m = -1 is :

A

10

B

14

C

2

D

6

Text Solution

AI Generated Solution

The correct Answer is:
To determine the maximum number of electrons that can exist in the orbital for which \( n = 3 \), \( l = 1 \), and \( m = -1 \), we can follow these steps: ### Step 1: Identify the Principal Quantum Number (n) The principal quantum number \( n \) indicates the energy level of the electron. Here, \( n = 3 \) means we are dealing with the third energy level. **Hint:** The principal quantum number \( n \) indicates the main energy level of the electron in an atom. ### Step 2: Identify the Azimuthal Quantum Number (l) The azimuthal quantum number \( l \) defines the shape of the orbital. For \( l = 1 \), the corresponding orbital is a p-orbital. **Hint:** The azimuthal quantum number \( l \) can take values from \( 0 \) to \( n-1 \). For \( l = 0 \) it's s, \( l = 1 \) is p, \( l = 2 \) is d, and \( l = 3 \) is f. ### Step 3: Determine the Magnetic Quantum Number (m) The magnetic quantum number \( m \) specifies the orientation of the orbital. For \( l = 1 \), the possible values of \( m \) are \( -1, 0, +1 \). Since we are given \( m = -1 \), we are focusing on one specific p-orbital. **Hint:** The magnetic quantum number \( m \) can take values from \( -l \) to \( +l \), giving a total of \( 2l + 1 \) orbitals for each value of \( l \). ### Step 4: Calculate the Maximum Number of Electrons Each orbital can hold a maximum of 2 electrons (due to the Pauli exclusion principle). Since we are considering the specific orbital defined by \( n = 3 \), \( l = 1 \), and \( m = -1 \), there is only one orbital available. **Hint:** Remember that each orbital can hold a maximum of 2 electrons, regardless of the quantum numbers. ### Step 5: Conclusion Therefore, the maximum number of electrons that can exist in the orbital for which \( n = 3 \), \( l = 1 \), and \( m = -1 \) is **2 electrons**. **Final Answer:** 2 electrons.
Promotional Banner

Topper's Solved these Questions

  • NTA NEET SET 115

    NTA MOCK TESTS|Exercise CHEMISTRY|45 Videos
  • NTA NEET SET 19

    NTA MOCK TESTS|Exercise CHEMISTRY|45 Videos

Similar Questions

Explore conceptually related problems

How many electrons can fit in the orbital for which n = 3 and l = 1 ?

The maximum number of electrons that d-orbital can contain is

The maximum number of unpaired electrons can present in p_(x) orbital is

The maximum number of electrons that can be present in an orbit with S=+(1)/(2) and l =2

The maximum number of electrons present in an orbit. l = 3 , is .

Maximum number of electrons that can be present in N shell is ______

Maximum number of electron that can exist in completely filled n=4 enrgy level.

The maximum number of electrons in an atom which can have n=4 is

NTA MOCK TESTS-NTA NEET SET 116-CHEMISTRY
  1. Two complexes [Cr(H(2)O(6))(6)]Cl(3) and [Cr(NH(3))(6)]Cl(3) (B) are v...

    Text Solution

    |

  2. Which one among the following is the mild oxdizing agent?

    Text Solution

    |

  3. Calculate the ionisation energy of sodium in "kJ mol"^(-1) if. Electro...

    Text Solution

    |

  4. Sodium crystallises in bcc arrangement with the interfacial separation...

    Text Solution

    |

  5. A detergent (C(12)H(25)SO^(4^-)Na^(+)) solution becomes colloidal sol...

    Text Solution

    |

  6. Which one of the following compounds is a peroxide?

    Text Solution

    |

  7. The three distances AB, AC and AA' in the given BCC lattice are :

    Text Solution

    |

  8. Isoelectric point is defined as the pH at which:

    Text Solution

    |

  9. The maximum number of electrons that can exists in the orbital for whi...

    Text Solution

    |

  10. What will be the product when an organic compound not containing any r...

    Text Solution

    |

  11. CH(3)CH=CH-CH=CH-CH(2)CHOHCH(3) How many isomers (geometrical and op...

    Text Solution

    |

  12. The rms speed of N(2) molecules in a gas in u. If the temperature is d...

    Text Solution

    |

  13. Which one of the following orders presents the correct sequence of the...

    Text Solution

    |

  14. The correct order of thermal stability of hydrides of group 15 is

    Text Solution

    |

  15. Carbinol is

    Text Solution

    |

  16. The order of the gaseous reaction A(g)rarr2B(g)+C(g) is found to be on...

    Text Solution

    |

  17. The correct decreasing order for acid strength is-

    Text Solution

    |

  18. The bad smelling substance formed by the action of alcoholic caustic p...

    Text Solution

    |

  19. Which one of the following is not a surfactant?

    Text Solution

    |

  20. Determine the solubility of silver chromate at 298 K given its K(sp) v...

    Text Solution

    |