Home
Class 12
CHEMISTRY
Which isotope of hydrogen is radioactive...

Which isotope of hydrogen is radioactive ?

Text Solution

AI Generated Solution

To determine which isotope of hydrogen is radioactive, we can follow these steps: ### Step 1: Understand the Isotopes of Hydrogen Hydrogen has three main isotopes: 1. Protium (¹H) - 1 proton, 0 neutrons 2. Deuterium (²H) - 1 proton, 1 neutron 3. Tritium (³H) - 1 proton, 2 neutrons ...
Promotional Banner

Topper's Solved these Questions

  • HYDROGEN

    AAKASH INSTITUTE|Exercise EXERCISE|10 Videos
  • HYDROGEN

    AAKASH INSTITUTE|Exercise ASSIGNMENT (SECTION - A) (objective type question)|30 Videos
  • HYDROGEN

    AAKASH INSTITUTE|Exercise Assignment (Section-J)|5 Videos
  • HYDROCARBONS

    AAKASH INSTITUTE|Exercise Assignment(Section - D) (Assertion -Reason Type Question)|24 Videos
  • M0ck test 26

    AAKASH INSTITUTE|Exercise EXAMPLE|40 Videos

Similar Questions

Explore conceptually related problems

Which isotope of hydrogen is/are radioactive in nature ?

Which of the following isotope of hydrogen is radioactive ?

Which isotope of carbon is radioactive?

The isotope of hydrogen which is radioactive is

Which isotope of hydrogen is called protium ?

The isotopes of hydrogen are:

Which isotope of hydrogen (i) does not contain neutron (ii) is radioactive ?

AAKASH INSTITUTE-HYDROGEN-EXAMPLES
  1. On the basis of electron affinity, comment on the resemblance of hydro...

    Text Solution

    |

  2. Which isotope of hydrogen is radioactive ?

    Text Solution

    |

  3. Which isotope of hydrogen contains equal number of protons and neutron...

    Text Solution

    |

  4. Comment on the reaction dihydrogen with fluorine.

    Text Solution

    |

  5. Explain the use of hydrogen in the formation of vegetable fats.

    Text Solution

    |

  6. Which class of covalent hydrides are considered as lewis acids?

    Text Solution

    |

  7. Association of molecules in water is due to:

    Text Solution

    |

  8. Describe the nature of ionic hydrides.

    Text Solution

    |

  9. Why do alcohol (a covalent compound) dissolves in water (ionic)?

    Text Solution

    |

  10. Which properties of hydrogen as responsible for moderation of the clim...

    Text Solution

    |

  11. Compare the density of ice and water.

    Text Solution

    |

  12. Does water gets oxidised in the process of photosynthesis?

    Text Solution

    |

  13. What type of water forms scum with soap?

    Text Solution

    |

  14. Write the reaction that takes place on adding lime to water containing...

    Text Solution

    |

  15. Explain with the help of reactions that how heavy water is used in the...

    Text Solution

    |

  16. What is calgon?

    Text Solution

    |

  17. Calculate the strength of 30 volume solution of hydrogen peroxide.

    Text Solution

    |

  18. What is the percentage strength of a solution of 100 volume H(2)O(2)?

    Text Solution

    |

  19. Why H(2)O(2) is kept away from dust?

    Text Solution

    |

  20. PbS(s)+4H(2)O(2)(aq)toPbSO(4)(s)+4H(2)O(l) In the above reaction, H(...

    Text Solution

    |