Home
Class 11
CHEMISTRY
The equilibrium constant for a reaction ...

The equilibrium constant for a reaction
`A+2B hArr 2C` is `40`. The equilibrium constant for reaction `C hArr B+1//2 A` is

A

`1//40`

B

`1//(40)^(1//2)`

C

`(1//40)^(2)`

D

40

Text Solution

Verified by Experts

The correct Answer is:
A, B
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    NARAYNA|Exercise Exercise -I (H.W.)|51 Videos

  • CHEMICAL EQUILIBRIUM

    NARAYNA|Exercise Exercise -II (C.W.)|51 Videos

  • CHEMICAL EQUILIBRIUM

    NARAYNA|Exercise C.U.Q.|50 Videos

  • CHEMICAL BONDING AND MOLECULAR STRUCTURE

    NARAYNA|Exercise EXERCISE -4|54 Videos

  • CLASSIFICATION OF ELEMENTS AND PERIODICITY

    NARAYNA|Exercise EXERCISE - 4|17 Videos

Similar Questions

Explore conceptually related problems

The equilibrium constant for the reaction 2A+2B hArr 2C+2D is 200 . The equilibrium constant for the reaction A+B hArr C+D , at the same temperature is ………..

The equilibrium constant for the reactions A+B hArr AB is 0.5 at 200K . The equilibrium constant for the reaction AB hArr A+B would be

At a certain temperature, the value of equilibrium constant for the reaction: A_2+2B_2(g) hArr 2AB_2 is 100. What is the equilibrium constant for the reaction. AB_2(g) hArr 1/2A_2 + B_2 ?

The equilibrium constant for the reaction A_(2)(g)+B_(2)(g) hArr 2AB(g) is 20 at 500K . The equilibrium constant for the reaction 2AB(g) hArr A_(2)(g)+B_(2)(g) would be

If the equilibrium constant of the reaction 2HIhArr H_(2)+I_(2) is 0.25, then the equilibrium constant for the reaction, H_(2)(g)+I_(2)(g)hArr 2HI(g) would be

If the equilibrium constant of the reaction 2HI hArrH_(2) + I_(2) is 0.25 , then the equilibrium constant of the reaction H_(2) + I_(2)hArr2HI would be

If the equilibrium constant for the reaction 2AB hArr A_(2)+B_(2) is 49, what is the value of equilibrium constant for ABhArr (1)/(2) A_(2)+(1)/(2)B_(2)

The equilibrium constant for the reaction H_(2)+Br_(2)hArr2HBr is 67.8 at 300(@)K . The equilibrium constant for the dissociation of HBr is:

If the value of equilibrium constant K_(c) for the reaction, N_(2)+3H_(2)hArr2NH_(3) is 7. The equilibrium constant for the reaction 2N_(2)+6H_(2)hArr4NH_(3) will be

NARAYNA-CHEMICAL EQUILIBRIUM-Exercise -I (C.W.)
  1. A((s))+B((g)) +" heat "Leftrightarrow 2C((s))+2D((g)). At equilibrium ...

    Text Solution

    |

  2. For A(2(g))+B(2(g)) underset(K(b)=15)overset(K(f)=5) Leftrightarrow 2A...

    Text Solution

    |

  3. The equilibrium constant for a reaction A+2B hArr 2C is 40. The equi...

    Text Solution

    |

  4. The equilibrium constant for the reaction N(2(g))+O(2(g)) Leftrightarr...

    Text Solution

    |

  5. In a reversible reaction, if the concentration of reactants are double...

    Text Solution

    |

  6. The unit for the equilibrium constant of the reaction

    Text Solution

    |

  7. For the equilibrium N(2)(g)+3H(2)(g) Leftrightarrow 2NH(3)(g)" at "100...

    Text Solution

    |

  8. In which of the following reactions, will the equilibrium mixture cont...

    Text Solution

    |

  9. The unit of equilibrium constant, K for the reaction, A+B rarr C , wou...

    Text Solution

    |

  10. The equilibrium constant for the reversible reaction N(2)+3H(2) hArr 2...

    Text Solution

    |

  11. The active mass of 64g of HI In a 2Lit flask would be

    Text Solution

    |

  12. AB(3)(g) is dissociation as AB(2)(g) hArr AB(2)(g)+(1)/(2)B(2)(g), W...

    Text Solution

    |

  13. In which one of the following gaseous equilibrium, K(p) is less than K...

    Text Solution

    |

  14. In the reaction H(2(g)) +l(2(g)) Leftrightarrow 2HI((g))

    Text Solution

    |

  15. The equilibrium of the reaction N(2)(g)+3H(2)(g) hArr 2NH(3)(g) will b...

    Text Solution

    |

  16. Consider the following equilibrium PCl(5(g)) Leftrightarrow PCl(3(g))+...

    Text Solution

    |

  17. One mole of A (g) is heated to 200^@ C in a one litre closed flask, ti...

    Text Solution

    |

  18. Consider the following reaction equilibrium N(2)(g) + 3H(2)(g) hArr...

    Text Solution

    |

  19. NH(4)HS(s)hArrNH(3)(g)+H(2)S(g) The3 equilibrium pressure at 25^(@)C ...

    Text Solution

    |

  20. One mole of A and 2 moles of B are allowed to react in a 0.5 lit flask...

    Text Solution

    |