Which of the following halides is not correct according to the name and classification?

Options

A. `CH_3CH_2C(CH)_2CH_2I`
1-Iodo-2, 2- dimethylbutane, Primary haloalkane
B. `(CH_3)_2CHCH(Cl)CH_3`
2-Chloro-3-methylbutane, Secondary haloalkane
C. `CH_3C(Cl)(C_2H_5)CH_2CH_3`
2- Chloro-2-ethylbutane, Secondary haloalkane
D. `CH_3-CH_2-overset(CH_3)overset(|)(CH)-overset(Cl)overset(|)(CH)-CH_2-CH_3`
3- Chloro -4-methylhexane, Secondary haloalkane

Explanation

To determine which halide is incorrectly named or classified, we will analyze each option step-by-step.

### Step 1: Analyze the First Compound
1. **Structure**: The first compound is represented as CH3-CH2-C(CH3)2-I.
2. **Numbering**: Start numbering from the end nearest to the halide (Iodine):
- 1: CH3
- 2: CH2
- 3: C (with two methyl groups)
- 4: I
3. **Name**: The correct name is 1-iodo-2,2-dimethylbutane.
4. **Classification**: The carbon with the halide (I) is attached to one other carbon, making it a primary haloalkane.

**Conclusion**: This option is correct.

### Step 2: Analyze the Second Compound
1. **Structure**: The second compound is CH3-CH(CH3)-C(CH3)-Cl.
2. **Numbering**: Start numbering from the end nearest to the halide (Chlorine):
- 1: CH3
- 2: CH
- 3: C (with two methyl groups)
- 4: Cl
3. **Name**: The correct name is 2-chloro-3-methylbutane.
4. **Classification**: The carbon with the halide (Cl) is attached to two other carbons, making it a secondary haloalkane.

**Conclusion**: This option is correct.

### Step 3: Analyze the Third Compound
1. **Structure**: The third compound is CH3-C(CH3)-Cl.
2. **Numbering**: Start numbering from the end nearest to the halide (Chlorine):
- 1: CH3
- 2: C (with a methyl group and Cl)
- 3: C2H5
3. **Name**: The correct name is 3-chloro-3-methylpentane.
4. **Classification**: The carbon with the halide (Cl) is attached to three other carbons, making it a tertiary haloalkane.

**Conclusion**: The option states it is a secondary haloalkane, which is incorrect. This is the incorrect option.

### Step 4: Analyze the Fourth Compound
1. **Structure**: The fourth compound is CH3-CH(CH3)-CH2-CH2-CH2-CH3.
2. **Numbering**: Start numbering from the end nearest to the halide (Chlorine):
- 1: CH3
- 2: CH
- 3: CH2 (with Cl)
- 4: CH3
3. **Name**: The correct name is 3-chloro-4-methylhexane.
4. **Classification**: The carbon with the halide (Cl) is attached to two other carbons, making it a secondary haloalkane.

**Conclusion**: This option is correct.

### Final Answer
The halide that is not correct according to the name and classification is the **third option**: 3-chloro-3-methylpentane classified as a secondary haloalkane.

---