Home
Class 12
MATHS
Which of the following real numbers when...

Which of the following real numbers when simplified are neither terminating nor repeating decimal ?

A

`sin75^(@)*cos75^(@)`

B

`log_(2)28`

C

`log_(3)5*log_(5)6`

D

`8^(-(log_(27)3))`

Text Solution

AI Generated Solution

The correct Answer is:
To determine which of the given real numbers are neither terminating nor repeating decimals, we will analyze each option step by step. ### Step 1: Analyze Option A **Given:** \( \sin 75^\circ \cdot \cos 75^\circ \) Using the double angle formula: \[ \sin 2A = 2 \sin A \cos A \] Let \( A = 75^\circ \): \[ \sin 75^\circ \cdot \cos 75^\circ = \frac{1}{2} \sin 150^\circ \] Now, we know: \[ \sin 150^\circ = \sin(180^\circ - 30^\circ) = \sin 30^\circ = \frac{1}{2} \] Thus, \[ \sin 75^\circ \cdot \cos 75^\circ = \frac{1}{2} \cdot \frac{1}{2} = \frac{1}{4} \] **Conclusion:** \( \frac{1}{4} \) is a rational number, which can be expressed as \( 0.25 \), a terminating decimal. ### Step 2: Analyze Option B **Given:** \( \log_2 28 \) We can break this down using properties of logarithms: \[ \log_2 28 = \log_2 (4 \cdot 7) = \log_2 4 + \log_2 7 \] Since \( 4 = 2^2 \): \[ \log_2 4 = 2 \] Now we have: \[ \log_2 28 = 2 + \log_2 7 \] Using the change of base formula: \[ \log_2 7 = \frac{\log_{10} 7}{\log_{10} 2} \] Calculating \( \log_{10} 7 \) gives approximately \( 0.845 \) and \( \log_{10} 2 \) gives approximately \( 0.301 \): \[ \log_2 7 \approx \frac{0.845}{0.301} \approx 2.807 \] Thus: \[ \log_2 28 \approx 2 + 2.807 = 4.807 \] **Conclusion:** This value is neither terminating nor repeating. ### Step 3: Analyze Option C **Given:** \( \log_5 3 \cdot \log_6 5 \) Using the change of base formula: \[ \log_5 3 = \frac{\log_{10} 3}{\log_{10} 5}, \quad \log_6 5 = \frac{\log_{10} 5}{\log_{10} 6} \] Thus: \[ \log_5 3 \cdot \log_6 5 = \frac{\log_{10} 3}{\log_{10} 5} \cdot \frac{\log_{10} 5}{\log_{10} 6} = \frac{\log_{10} 3}{\log_{10} 6} \] Calculating \( \log_{10} 3 \approx 0.477 \) and \( \log_{10} 6 \approx 0.778 \): \[ \frac{\log_{10} 3}{\log_{10} 6} \approx \frac{0.477}{0.778} \approx 0.613 \] **Conclusion:** This value is also neither terminating nor repeating. ### Step 4: Analyze Option D **Given:** \( 8^{-\log_{27} 3} \) Using properties of logarithms: \[ \log_{27} 3 = \frac{\log_{10} 3}{\log_{10} 27} = \frac{\log_{10} 3}{3 \log_{10} 3} = \frac{1}{3} \] Thus: \[ 8^{-\log_{27} 3} = 8^{-\frac{1}{3}} = \frac{1}{8^{\frac{1}{3}}} = \frac{1}{2} \] **Conclusion:** \( \frac{1}{2} \) is a rational number and a terminating decimal. ### Final Conclusion Out of the four options, the numbers that are neither terminating nor repeating decimals are: - **Option B:** \( \log_2 28 \) - **Option C:** \( \log_5 3 \cdot \log_6 5 \)
Promotional Banner

Topper's Solved these Questions

  • COMPOUND ANGLES

    VIKAS GUPTA (BLACK BOOK) ENGLISH|Exercise Exercise-3 : Comprehension Type Problems|12 Videos
  • COMPOUND ANGLES

    VIKAS GUPTA (BLACK BOOK) ENGLISH|Exercise Exercise-4 : Matching Type Problems|5 Videos
  • COMPOUND ANGLES

    VIKAS GUPTA (BLACK BOOK) ENGLISH|Exercise Exercise-5 : Subjective Type Problems|31 Videos
  • COMPLEX NUMBERS

    VIKAS GUPTA (BLACK BOOK) ENGLISH|Exercise EXERCISE-5 : SUBJECTIVE TYPE PROBLEMS|8 Videos
  • CONTINUITY, DIFFERENTIABILITY AND DIFFERENTIATION

    VIKAS GUPTA (BLACK BOOK) ENGLISH|Exercise EXERCISE (SUBJECTIVE TYPE PROBLEMS)|24 Videos

Similar Questions

Explore conceptually related problems

Which of the following real numbers when simplified are either terminating or rerepeating decimal ? (A) sin((3pi)/8)cos((3pi)/8)(B)log_2(112)(C)log_3 2log_4 3log_8 4(D)27^(-log_25(5))

Without actual division , show that each of the following rational numbers is expressible as a non - terminating and repeating decimal : 25/66

Without actual division , show that each of the following rational numbers is expressible as a non - terminating and repeating decimal : 5/6

Without actual division , show that each of the following rational numbers is expressible as a non - terminating and repeating decimal : 27/38

Which of the following are like decimal numbers ?

Which of the following numbers can be represented as non-terminating, repeating decimals? A. (39)/(24) B. 3/(16) C. 3/(11) D. (137)/(25)

Which of the following reaction(s) is/are neither sterospecific nor steroselective?

Which of the following reactions involves neither oxidation nor reduction ?

Which of the following has neither secondary nor tertiary hydrogen?

Which of the following physical quantities has neither units nor dimensions?

VIKAS GUPTA (BLACK BOOK) ENGLISH-COMPOUND ANGLES-Exercise-2 : One or More than One Answer is/are Correct
  1. If sin(x+20^0)=2sinxcos40^0,w h r ex in (0,pi/2), then which of the fo...

    Text Solution

    |

  2. If 2(cos(x-y)+cos(y-z)+cos(z-x))=-3, then :

    Text Solution

    |

  3. If 0 lt x lt pi/2 and sin^(n) x + cos^(n) x ge 1, then

    Text Solution

    |

  4. If x=sin(alpha-beta)*sin(gamma-delta), y=sin(beta-gamma)*sin(alpha-de...

    Text Solution

    |

  5. If x = X cos theta- Y sin theta, y = X sin theta + Y cos theta and x^2...

    Text Solution

    |

  6. If 2a=2tan10^(@)+tan50^(@), 2b=tan20^(@)+tan50^(@) 2c=2tan10^(@)+tan...

    Text Solution

    |

  7. Which of the following real numbers when simplified are neither termi...

    Text Solution

    |

  8. If a=sinxcos^3x and b=cosxsin^3x then

    Text Solution

    |

  9. If (pi)/(2) lt theta lt pi, then possible answers of sqrt(2+sqrt(2+2c...

    Text Solution

    |

  10. If cot^(3)alpha+cot^(2)alpha+cot alpha=1 then which of the following...

    Text Solution

    |

  11. The value of x in (0,pi/2) satisfying (sqrt(3)-1)/(sinx)+(sqrt(3)+1)/(...

    Text Solution

    |

  12. If alpha gt (1)/(sin^(6)x+cos^(6)x) AA x in R, then alpha can be

    Text Solution

    |

  13. If x in (0, (pi)/(2)) and sinx=(3)/(sqrt(10)), Let k=log(10)sinx+log...

    Text Solution

    |

  14. If A, B, C are angles of Delta ABC and tan A tan C = 3, tan B tan C =...

    Text Solution

    |

  15. The value of (sin x-cos x)/(sin^(3)x) is equal to :

    Text Solution

    |

  16. If f(x)=sin^(2)x+sin^(2)(x+(2pi)/(3))+sin^(2)(x+(4pi)/(3)) then :

    Text Solution

    |

  17. The range of y=(sin4x-sin2x)/(sin4x+sin2x) satisfies

    Text Solution

    |

  18. If sqrt(2)cos A=cos B+cos^3B ,a n dsqrt(2)sinA=sinB-sin^3Bt h e nsin(A...

    Text Solution

    |

  19. If alpha gt (1)/(sin^(6)x+cos^(6)x) AA x in R, then alpha can be

    Text Solution

    |

  20. If cot^(3)alpha+cot^(2)alpha+cot alpha=1 then which of the following i...

    Text Solution

    |