Home
Class 12
MATHS
Which of the following real numbers when...

Which of the following real numbers when simplified are neither terminating nor repeating decimal ?

A

`sin75^(@)*cos75^(@)`

B

`log_(2)28`

C

`log_(3)5*log_(5)6`

D

`8^(-(log_(27)3))`

Text Solution

AI Generated Solution

The correct Answer is:
To determine which of the given real numbers, when simplified, are neither terminating nor repeating decimals, we will analyze each option step by step. ### Step 1: Analyze the first option **Option 1: \( \sin(75^\circ) \cdot \cos(75^\circ) \)** 1. We can use the identity \( 2 \sin A \cos A = \sin(2A) \). 2. Therefore, \( \sin(75^\circ) \cdot \cos(75^\circ) = \frac{1}{2} \sin(150^\circ) \). 3. Now, \( \sin(150^\circ) = \sin(30^\circ) = \frac{1}{2} \). 4. Thus, \( \sin(75^\circ) \cdot \cos(75^\circ) = \frac{1}{2} \cdot \frac{1}{2} = \frac{1}{4} \). 5. The decimal representation of \( \frac{1}{4} \) is \( 0.25 \), which is a terminating decimal. **Conclusion for Option 1:** This option is not correct. ### Step 2: Analyze the second option **Option 2: \( \log_2(28) \)** 1. Let \( x = \log_2(28) \). 2. By the definition of logarithms, this means \( 2^x = 28 \). 3. The value of \( x \) is not an integer because \( 2^4 = 16 \) and \( 2^5 = 32 \), so \( x \) lies between 4 and 5. 4. Since \( x \) is not an integer, \( \log_2(28) \) cannot be expressed as a terminating or repeating decimal. **Conclusion for Option 2:** This option is correct. ### Step 3: Analyze the third option **Option 3: \( \log_3(5) \cdot \log_5(6) \)** 1. We can apply the change of base formula: \( \log_a(b) = \frac{\log_c(b)}{\log_c(a)} \). 2. Thus, \( \log_3(5) \) and \( \log_5(6) \) will yield fractional values because they do not simplify to integers. 3. The product of two non-integer logarithms will also be a non-integer, meaning it cannot be a terminating or repeating decimal. **Conclusion for Option 3:** This option is correct. ### Step 4: Analyze the fourth option **Option 4: \( 8^{- \log_{27}(3)} \)** 1. We can rewrite \( \log_{27}(3) \) using the change of base formula: \( \log_{27}(3) = \frac{\log(3)}{\log(27)} \). 2. Since \( 27 = 3^3 \), we have \( \log(27) = 3 \log(3) \). 3. Thus, \( \log_{27}(3) = \frac{\log(3)}{3 \log(3)} = \frac{1}{3} \). 4. Therefore, \( 8^{- \log_{27}(3)} = 8^{-\frac{1}{3}} = \frac{1}{8^{\frac{1}{3}}} = \frac{1}{2} \). 5. The decimal representation of \( \frac{1}{2} \) is \( 0.5 \), which is a terminating decimal. **Conclusion for Option 4:** This option is not correct. ### Final Conclusion The options that yield neither terminating nor repeating decimals are: - **Option 2: \( \log_2(28) \)** - **Option 3: \( \log_3(5) \cdot \log_5(6) \)**
Promotional Banner

Topper's Solved these Questions

  • COMPOUND ANGLES

    VK JAISWAL ENGLISH|Exercise Exercise-3 : Comprehension Type Problems|12 Videos
  • COMPOUND ANGLES

    VK JAISWAL ENGLISH|Exercise Exercise-4 : Matching Type Problems|1 Videos
  • COMPOUND ANGLES

    VK JAISWAL ENGLISH|Exercise Exercise-5 : Subjective Type Problems|31 Videos
  • COMPLEX NUMBERS

    VK JAISWAL ENGLISH|Exercise EXERCISE-5 : SUBJECTIVE TYPE PROBLEMS|8 Videos
  • CONTINUITY, DIFFERENTIABILITY AND DIFFERENTIATION

    VK JAISWAL ENGLISH|Exercise EXERCISE (SUBJECTIVE TYPE PROBLEMS)|22 Videos

Similar Questions

Explore conceptually related problems

Which of the following real numbers when simplified are either terminating or rerepeating decimal ? (A) sin((3pi)/8)cos((3pi)/8)(B)log_2(112)(C)log_3 2log_4 3log_8 4(D)27^(-log_25(5))

Without actual division , show that each of the following rational numbers is expressible as a non - terminating and repeating decimal : 25/66

Without actual division , show that each of the following rational numbers is expressible as a non - terminating and repeating decimal : 5/6

Without actual division , show that each of the following rational numbers is expressible as a non - terminating and repeating decimal : 27/38

Which of the following are like decimal numbers ?

Which of the following numbers can be represented as non-terminating, repeating decimals? A. (39)/(24) B. 3/(16) C. 3/(11) D. (137)/(25)

Which of the following reaction(s) is/are neither sterospecific nor steroselective?

Which of the following reactions involves neither oxidation nor reduction ?

Which of the following has neither secondary nor tertiary hydrogen?

Which of the following physical quantities has neither units nor dimensions?

VK JAISWAL ENGLISH-COMPOUND ANGLES-Exercise-2 : One or More than One Answer is/are Correct
  1. If sin(x+20^0)=2sinxcos40^0,w h r ex in (0,pi/2), then which of the fo...

    Text Solution

    |

  2. If cosx + cosy + cosz = 0 and sinx + siny + sinz =0, then show that ...

    Text Solution

    |

  3. If 0 lt x lt pi/2 and sin^(n) x + cos^(n) x ge 1, then

    Text Solution

    |

  4. If x=sin(alpha-beta)*sin(gamma-delta), y=sin(beta-gamma)*sin(alpha-de...

    Text Solution

    |

  5. If X=x cos theta-y sin theta, Y=x sin theta+y cos theta and X^(2)+4XY...

    Text Solution

    |

  6. If 2a=2tan10^(@)+tan50^(@), 2b=tan20^(@)+tan50^(@) 2c=2tan10^(@)+tan...

    Text Solution

    |

  7. Which of the following real numbers when simplified are neither termi...

    Text Solution

    |

  8. If alpha=sin x cos^(3) x and beta=cos x sin^(3) x, then :

    Text Solution

    |

  9. If (pi)/(2) lt theta lt pi, then possible answers of sqrt(2+sqrt(2+2c...

    Text Solution

    |

  10. If cot^(3)alpha+cot^(2)alpha+cot alpha=1 then which of the following...

    Text Solution

    |

  11. The value of x in (0,pi/2) satisfying (sqrt(3)-1)/(sinx)+(sqrt(3)+1)/(...

    Text Solution

    |

  12. If alpha gt (1)/(sin^(6)x+cos^(6)x) AA x in R, then alpha can be

    Text Solution

    |

  13. If x in (0, (pi)/(2)) and sinx=(3)/(sqrt(10)), Let k=log(10)sinx+log...

    Text Solution

    |

  14. If A, B, C are angles of a triangle ABC and tanAtanC=3, tan B tanC=6 t...

    Text Solution

    |

  15. The value of (sin x-cos x)/(sin^(3)x) is equal to :

    Text Solution

    |

  16. If f(x)=sin^(2)x+sin^(2)(x+(2pi)/(3))+sin^(2)(x+(4pi)/(3)) then :

    Text Solution

    |

  17. The range of y=(sin4x-sin2x)/(sin4x+sin2x) satisfies

    Text Solution

    |

  18. If sqrt(2)cos A=cos B+cos^3B ,a n dsqrt(2)sinA=sinB-sin^3Bt h e nsin(A...

    Text Solution

    |

  19. If alpha gt (1)/(sin^(6)x+cos^(6)x) AA x in R, then alpha can be

    Text Solution

    |

  20. If cot^(3)alpha+cot^(2)alpha+cot alpha=1 then which of the following...

    Text Solution

    |