Home
Class 12
CHEMISTRY
Which isotope of hydrogen contains equal...

Which isotope of hydrogen contains equal number of protons and neutrons?

Text Solution

Verified by Experts

Deuterium `(""_1^2D)`. It has one proton and one neutron.
Promotional Banner

Topper's Solved these Questions

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise EXERCISE|10 Videos

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise ASSIGNMENT (SECTION - A) (objective type question)|29 Videos

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise Assignment (Section-J)|5 Videos

  • HYDROCARBONS

    AAKASH INSTITUTE ENGLISH|Exercise Assignment(Section - C) (Previous Years Questions)|60 Videos

  • M0ck test 26

    AAKASH INSTITUTE ENGLISH|Exercise EXAMPLE|43 Videos

Similar Questions

Explore conceptually related problems

The isotopes of hydrogen are:

Which isotope of hydrogen has no neutron?

What is the name of the isotope of hydrogen which contains 1 proton and 1 neutron?

Which of the following atom does not contain the same number of protons and neutrons in its nucleus?

Electron, Proton and Neutron

Find the binding energy of a nucleus consisting of equal numbers of protons and neutrons and having the radius one and a half time smaller than of Al^(27) nucleus.

Which of the following has magic number of protons and neutrons?

Which of the following has magic number of protons and neutrons?

Atomic number is the sum of number of protons and neutrons.

One isotope of uranium has a mass number 235 and atomic number 92. (i) What is the number of electrons in the neutral atom of this isotope ? (ii) What is the number of protons and number of neutrons in its nucleus ? (iii) Do all isotopes have the same number of neutrons ? (iv) What is the number of protons and neutrons in ""_(92)^(238) U ?

AAKASH INSTITUTE ENGLISH-HYDROGEN-EXAMPLES
  1. Discuss the resemblance of hydrogen with halogens.

    Text Solution

    |

  2. Which isotope of hydrogen is radioactive in nature?

    Text Solution

    |

  3. Which isotope of hydrogen contains equal number of protons and neutron...

    Text Solution

    |

  4. Comment on the reaction of dihydrogen with fluorine.

    Text Solution

    |

  5. Explain the use of hydrogen in the formation of vegetable fats.

    Text Solution

    |

  6. Which class of covalent hydrides are considered as lewis acids?

    Text Solution

    |

  7. Association of molecules in water is due to:

    Text Solution

    |

  8. Describe the nature of ionic hydrides.

    Text Solution

    |

  9. Why do alcohol (a covalent compound) dissolves in water (ionic)?

    Text Solution

    |

  10. Which properties of hydrogen as responsible for moderation of the clim...

    Text Solution

    |

  11. Compare the density of ice and water.

    Text Solution

    |

  12. Does water gets oxidised in the process of photosynthesis?

    Text Solution

    |

  13. What type of water forms scum with soap?

    Text Solution

    |

  14. Write the reaction that takes place on adding lime to water containing...

    Text Solution

    |

  15. Explain with the help of reactions that how heavy water is used in the...

    Text Solution

    |

  16. What is calgon?

    Text Solution

    |

  17. Calculate the strength of 30 volume solution of hydrogen peroxide.

    Text Solution

    |

  18. What is the percentage strength of a solution of 100 volume H(2)O(2)?

    Text Solution

    |

  19. Why H(2)O(2) is kept away from dust?

    Text Solution

    |

  20. PbS(s)+4H(2)O(2)(aq)toPbSO(4)(s)+4H(2)O(l) In the above reaction, H(...

    Text Solution

    |