Home
Class 12
CHEMISTRY
Association of molecules in water is du...

Association of molecules in water is due to:

Text Solution

AI Generated Solution

**Step-by-Step Solution:** 1. **Understanding the Question**: The question asks about the reason behind the association of molecules in water. Here, we need to identify the type of bonding that leads to this association. 2. **Identifying the Type of Bonding**: The association of water molecules occurs due to intermolecular forces. Specifically, we are looking for the type of intermolecular bonding present in water. 3. **Defining Hydrogen Bonding**: Hydrogen bonding is a specific type of intermolecular force that occurs when a hydrogen atom covalently bonded to a highly electronegative atom (like oxygen) is attracted to another electronegative atom. In water (H₂O), each water molecule can form hydrogen bonds with neighboring water molecules. ...
Promotional Banner

Topper's Solved these Questions

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise EXERCISE|10 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise ASSIGNMENT (SECTION - A) (objective type question)|29 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise Assignment (Section-J)|5 Videos
  • HYDROCARBONS

    AAKASH INSTITUTE ENGLISH|Exercise Assignment(Section - C) (Previous Years Questions)|60 Videos
  • M0ck test 26

    AAKASH INSTITUTE ENGLISH|Exercise EXAMPLE|43 Videos

Similar Questions

Explore conceptually related problems

Property of adhesion of water molecules to cell walls is due to

Cohesive force of water is due to

The solubility of inert gases in water is due to

Silicones repel water due to:

The mass of a molecule of water

Concentration of water molecules in a system determines

The solubility ofmethanol in water is due to the fact that :

Gum swells up in the water due to

Gum swells up in the water due to

Number of ATP molecules formed from 8 molecules of water due to noncyclic electron transport and subsequent photophosphorylation is

AAKASH INSTITUTE ENGLISH-HYDROGEN-EXAMPLES
  1. Discuss the resemblance of hydrogen with halogens.

    Text Solution

    |

  2. Which isotope of hydrogen is radioactive in nature?

    Text Solution

    |

  3. Which isotope of hydrogen contains equal number of protons and neutron...

    Text Solution

    |

  4. Comment on the reaction of dihydrogen with fluorine.

    Text Solution

    |

  5. Explain the use of hydrogen in the formation of vegetable fats.

    Text Solution

    |

  6. Which class of covalent hydrides are considered as lewis acids?

    Text Solution

    |

  7. Association of molecules in water is due to:

    Text Solution

    |

  8. Describe the nature of ionic hydrides.

    Text Solution

    |

  9. Why do alcohol (a covalent compound) dissolves in water (ionic)?

    Text Solution

    |

  10. Which properties of hydrogen as responsible for moderation of the clim...

    Text Solution

    |

  11. Compare the density of ice and water.

    Text Solution

    |

  12. Does water gets oxidised in the process of photosynthesis?

    Text Solution

    |

  13. What type of water forms scum with soap?

    Text Solution

    |

  14. Write the reaction that takes place on adding lime to water containing...

    Text Solution

    |

  15. Explain with the help of reactions that how heavy water is used in the...

    Text Solution

    |

  16. What is calgon?

    Text Solution

    |

  17. Calculate the strength of 30 volume solution of hydrogen peroxide.

    Text Solution

    |

  18. What is the percentage strength of a solution of 100 volume H(2)O(2)?

    Text Solution

    |

  19. Why H(2)O(2) is kept away from dust?

    Text Solution

    |

  20. PbS(s)+4H(2)O(2)(aq)toPbSO(4)(s)+4H(2)O(l) In the above reaction, H(...

    Text Solution

    |