Home
Class 12
CHEMISTRY
Does water gets oxidised in the process ...

Does water gets oxidised in the process of photosynthesis?

Text Solution

AI Generated Solution

To determine whether water gets oxidized in the process of photosynthesis, we can analyze the chemical reaction involved in photosynthesis and the changes in oxidation states of the elements involved. ### Step-by-Step Solution: 1. **Understanding Photosynthesis**: - Photosynthesis is the process by which plants convert carbon dioxide and water into glucose and oxygen using sunlight. The overall balanced equation for photosynthesis can be represented as: \[ 6CO_2 + 6H_2O \xrightarrow{light} C_6H_{12}O_6 + 6O_2 ...
Promotional Banner

Topper's Solved these Questions

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise EXERCISE|10 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise ASSIGNMENT (SECTION - A) (objective type question)|29 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise Assignment (Section-J)|5 Videos
  • HYDROCARBONS

    AAKASH INSTITUTE ENGLISH|Exercise Assignment(Section - C) (Previous Years Questions)|60 Videos
  • M0ck test 26

    AAKASH INSTITUTE ENGLISH|Exercise EXAMPLE|43 Videos

Similar Questions

Explore conceptually related problems

The process of photosynthesis is

Usually the process of photosynthesis is :

The element which helps in oxygen evolution in the process of photosynthesis is

Describe any three external factors affecting the process of photosynthesis

The percentage of solar radiation absorbed by all the green plants for the process of photosynthesis is about

Which property of the pigment is responsible for its ability to initiate the process of photosynthesis ? Why is the rate of photosynthesis higher in the red and blue regions of the spectrum of light ?

The diagram given below represents an experiment to prove the importance of a factor in photosynthesis. Answer the questions that follow Explain the process of Photosynthesis

(a) What a photosynthesis ? (b) Write a chemical equation to show the process of photosynthesis in plants. (c) Explain the mechanism of photosynthesis

O_(2) released in the process of photosynthesis comes from

AAKASH INSTITUTE ENGLISH-HYDROGEN-EXAMPLES
  1. Discuss the resemblance of hydrogen with halogens.

    Text Solution

    |

  2. Which isotope of hydrogen is radioactive in nature?

    Text Solution

    |

  3. Which isotope of hydrogen contains equal number of protons and neutron...

    Text Solution

    |

  4. Comment on the reaction of dihydrogen with fluorine.

    Text Solution

    |

  5. Explain the use of hydrogen in the formation of vegetable fats.

    Text Solution

    |

  6. Which class of covalent hydrides are considered as lewis acids?

    Text Solution

    |

  7. Association of molecules in water is due to:

    Text Solution

    |

  8. Describe the nature of ionic hydrides.

    Text Solution

    |

  9. Why do alcohol (a covalent compound) dissolves in water (ionic)?

    Text Solution

    |

  10. Which properties of hydrogen as responsible for moderation of the clim...

    Text Solution

    |

  11. Compare the density of ice and water.

    Text Solution

    |

  12. Does water gets oxidised in the process of photosynthesis?

    Text Solution

    |

  13. What type of water forms scum with soap?

    Text Solution

    |

  14. Write the reaction that takes place on adding lime to water containing...

    Text Solution

    |

  15. Explain with the help of reactions that how heavy water is used in the...

    Text Solution

    |

  16. What is calgon?

    Text Solution

    |

  17. Calculate the strength of 30 volume solution of hydrogen peroxide.

    Text Solution

    |

  18. What is the percentage strength of a solution of 100 volume H(2)O(2)?

    Text Solution

    |

  19. Why H(2)O(2) is kept away from dust?

    Text Solution

    |

  20. PbS(s)+4H(2)O(2)(aq)toPbSO(4)(s)+4H(2)O(l) In the above reaction, H(...

    Text Solution

    |