Home
Class 12
CHEMISTRY
What type of water forms scum with soap?...

What type of water forms scum with soap?

Text Solution

AI Generated Solution

### Step-by-Step Solution: 1. **Understanding Water Types**: - Water can be classified into two main types: soft water and hard water. - Soft water is free from dissolved minerals, while hard water contains significant amounts of dissolved minerals, particularly calcium and magnesium. 2. **Identifying Hard Water**: - Hard water contains impurities such as calcium (Ca²⁺) and magnesium (Mg²⁺) ions. ...
Promotional Banner

Topper's Solved these Questions

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise EXERCISE|10 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise ASSIGNMENT (SECTION - A) (objective type question)|29 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise Assignment (Section-J)|5 Videos
  • HYDROCARBONS

    AAKASH INSTITUTE ENGLISH|Exercise Assignment(Section - C) (Previous Years Questions)|60 Videos
  • M0ck test 26

    AAKASH INSTITUTE ENGLISH|Exercise EXAMPLE|43 Videos

Similar Questions

Explore conceptually related problems

What type of lattices are formed by alkali metal and alkaline earth metal hydrides

What type of solutions are formed on dissolving different concentrations of soap in water ?

Hard water forms lather with soap easily.

What is the problem with hard water for washing clothes with soap ?

What type of mixture is formed when lime juice is mixed in water?

What type of hydrides are formed by Be and Mg?

Why does hard water not from lather with soap ?

What type of substances form hydrophobic sols?

What type of substances form lyophobic sols ?

What type of hydrides are formed by transition elements ?

AAKASH INSTITUTE ENGLISH-HYDROGEN-EXAMPLES
  1. Discuss the resemblance of hydrogen with halogens.

    Text Solution

    |

  2. Which isotope of hydrogen is radioactive in nature?

    Text Solution

    |

  3. Which isotope of hydrogen contains equal number of protons and neutron...

    Text Solution

    |

  4. Comment on the reaction of dihydrogen with fluorine.

    Text Solution

    |

  5. Explain the use of hydrogen in the formation of vegetable fats.

    Text Solution

    |

  6. Which class of covalent hydrides are considered as lewis acids?

    Text Solution

    |

  7. Association of molecules in water is due to:

    Text Solution

    |

  8. Describe the nature of ionic hydrides.

    Text Solution

    |

  9. Why do alcohol (a covalent compound) dissolves in water (ionic)?

    Text Solution

    |

  10. Which properties of hydrogen as responsible for moderation of the clim...

    Text Solution

    |

  11. Compare the density of ice and water.

    Text Solution

    |

  12. Does water gets oxidised in the process of photosynthesis?

    Text Solution

    |

  13. What type of water forms scum with soap?

    Text Solution

    |

  14. Write the reaction that takes place on adding lime to water containing...

    Text Solution

    |

  15. Explain with the help of reactions that how heavy water is used in the...

    Text Solution

    |

  16. What is calgon?

    Text Solution

    |

  17. Calculate the strength of 30 volume solution of hydrogen peroxide.

    Text Solution

    |

  18. What is the percentage strength of a solution of 100 volume H(2)O(2)?

    Text Solution

    |

  19. Why H(2)O(2) is kept away from dust?

    Text Solution

    |

  20. PbS(s)+4H(2)O(2)(aq)toPbSO(4)(s)+4H(2)O(l) In the above reaction, H(...

    Text Solution

    |