Home
Class 12
CHEMISTRY
Write the reaction that takes place on a...

Write the reaction that takes place on adding lime to water containing magnesium bicarbonate.

Text Solution

AI Generated Solution

To solve the question regarding the reaction that takes place when lime (calcium hydroxide) is added to water containing magnesium bicarbonate, we can follow these steps: ### Step-by-Step Solution: 1. **Identify the Reactants**: - The reactants in this case are magnesium bicarbonate \((\text{Mg(HCO}_3\text{)}_2)\) and lime (calcium hydroxide, \(\text{Ca(OH)}_2\)). 2. **Write the Initial Reaction**: ...
Promotional Banner

Topper's Solved these Questions

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise EXERCISE|10 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise ASSIGNMENT (SECTION - A) (objective type question)|29 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise Assignment (Section-J)|5 Videos
  • HYDROCARBONS

    AAKASH INSTITUTE ENGLISH|Exercise Assignment(Section - C) (Previous Years Questions)|60 Videos
  • M0ck test 26

    AAKASH INSTITUTE ENGLISH|Exercise EXAMPLE|43 Videos

Similar Questions

Explore conceptually related problems

The reaction take place by mechanism is

The light reaction does not take place in

Absorption of water takes place in

Reaction taking place during smelting is

What is the amount of lime Ca(OH) 2 ​ required to remove the hardness in 60 litres of pond water containing 1.62 mg of calcium bicarbonate per 100 mL of water?

Ammonia can be obtained by adding water to Magnesium nitrate.

Write the equations for the formation of ammonia by the action of water on magnesium nitride

Reaction taking place in a fuel cells are:

Slake lime is prepared by adding water to

Why is alum added to water containing suspended impurities ?

AAKASH INSTITUTE ENGLISH-HYDROGEN-EXAMPLES
  1. Discuss the resemblance of hydrogen with halogens.

    Text Solution

    |

  2. Which isotope of hydrogen is radioactive in nature?

    Text Solution

    |

  3. Which isotope of hydrogen contains equal number of protons and neutron...

    Text Solution

    |

  4. Comment on the reaction of dihydrogen with fluorine.

    Text Solution

    |

  5. Explain the use of hydrogen in the formation of vegetable fats.

    Text Solution

    |

  6. Which class of covalent hydrides are considered as lewis acids?

    Text Solution

    |

  7. Association of molecules in water is due to:

    Text Solution

    |

  8. Describe the nature of ionic hydrides.

    Text Solution

    |

  9. Why do alcohol (a covalent compound) dissolves in water (ionic)?

    Text Solution

    |

  10. Which properties of hydrogen as responsible for moderation of the clim...

    Text Solution

    |

  11. Compare the density of ice and water.

    Text Solution

    |

  12. Does water gets oxidised in the process of photosynthesis?

    Text Solution

    |

  13. What type of water forms scum with soap?

    Text Solution

    |

  14. Write the reaction that takes place on adding lime to water containing...

    Text Solution

    |

  15. Explain with the help of reactions that how heavy water is used in the...

    Text Solution

    |

  16. What is calgon?

    Text Solution

    |

  17. Calculate the strength of 30 volume solution of hydrogen peroxide.

    Text Solution

    |

  18. What is the percentage strength of a solution of 100 volume H(2)O(2)?

    Text Solution

    |

  19. Why H(2)O(2) is kept away from dust?

    Text Solution

    |

  20. PbS(s)+4H(2)O(2)(aq)toPbSO(4)(s)+4H(2)O(l) In the above reaction, H(...

    Text Solution

    |