Home
Class 12
CHEMISTRY
What is calgon?...

What is calgon?

Text Solution

AI Generated Solution

**Step-by-Step Text Solution:** 1. **Definition of Calgon**: Calgon is a commercial name for a chemical compound known as sodium hexametaphosphate. 2. **Chemical Formula**: The chemical formula for sodium hexametaphosphate is NaPO3·6. This indicates that it consists of six units of metaphosphate. 3. **Alternative Representation**: Sodium hexametaphosphate can also be represented in a different chemical formula as Na2, Na4, P6, O18. This shows the composition of sodium, phosphorus, and oxygen in the compound. ...
Promotional Banner

Topper's Solved these Questions

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise EXERCISE|10 Videos

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise ASSIGNMENT (SECTION - A) (objective type question)|29 Videos

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise Assignment (Section-J)|5 Videos

  • HYDROCARBONS

    AAKASH INSTITUTE ENGLISH|Exercise Assignment(Section - C) (Previous Years Questions)|60 Videos

  • M0ck test 26

    AAKASH INSTITUTE ENGLISH|Exercise EXAMPLE|43 Videos

Similar Questions

Explore conceptually related problems

What is teflon? What are its uses ?

What is a unit? What are its characteristics?

(a) What is a slag ? (b) What is meant by the term 'Pyrometallurgy' ?

What is carbylamine reaction and what is its significance ?

What is concentration quotient and what is its significance?

Polyphosphates llike sodium hexametaphosphate (calgon) are used as water softening agents because they

What is a soap, what for is it used ?

What is matter? What is it made of?

What is anaphylaxis? What are the symptoms of it?

What is a couple? What is its action?

AAKASH INSTITUTE ENGLISH-HYDROGEN-EXAMPLES
  1. Discuss the resemblance of hydrogen with halogens.

    Text Solution

    |

  2. Which isotope of hydrogen is radioactive in nature?

    Text Solution

    |

  3. Which isotope of hydrogen contains equal number of protons and neutron...

    Text Solution

    |

  4. Comment on the reaction of dihydrogen with fluorine.

    Text Solution

    |

  5. Explain the use of hydrogen in the formation of vegetable fats.

    Text Solution

    |

  6. Which class of covalent hydrides are considered as lewis acids?

    Text Solution

    |

  7. Association of molecules in water is due to:

    Text Solution

    |

  8. Describe the nature of ionic hydrides.

    Text Solution

    |

  9. Why do alcohol (a covalent compound) dissolves in water (ionic)?

    Text Solution

    |

  10. Which properties of hydrogen as responsible for moderation of the clim...

    Text Solution

    |

  11. Compare the density of ice and water.

    Text Solution

    |

  12. Does water gets oxidised in the process of photosynthesis?

    Text Solution

    |

  13. What type of water forms scum with soap?

    Text Solution

    |

  14. Write the reaction that takes place on adding lime to water containing...

    Text Solution

    |

  15. Explain with the help of reactions that how heavy water is used in the...

    Text Solution

    |

  16. What is calgon?

    Text Solution

    |

  17. Calculate the strength of 30 volume solution of hydrogen peroxide.

    Text Solution

    |

  18. What is the percentage strength of a solution of 100 volume H(2)O(2)?

    Text Solution

    |

  19. Why H(2)O(2) is kept away from dust?

    Text Solution

    |

  20. PbS(s)+4H(2)O(2)(aq)toPbSO(4)(s)+4H(2)O(l) In the above reaction, H(...

    Text Solution

    |