Home
Class 12
CHEMISTRY
Calculate the strength of 30 volume solu...

Calculate the strength of 30 volume solution of hydrogen peroxide.

Text Solution

AI Generated Solution

To calculate the strength of a 30 volume solution of hydrogen peroxide (H2O2), we can follow these steps: ### Step 1: Understand Volume Strength Volume strength indicates the volume of oxygen gas (O2) that can be liberated by the decomposition of a certain volume of hydrogen peroxide. A 30 volume solution means that 1 liter of this solution can release 30 liters of oxygen gas. ### Step 2: Write the Decomposition Reaction The decomposition of hydrogen peroxide can be represented by the following balanced chemical equation: \[ 2 \text{H}_2\text{O}_2 \rightarrow 2 \text{H}_2\text{O} + \text{O}_2 \] ...
Promotional Banner

Topper's Solved these Questions

  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise EXERCISE|10 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise ASSIGNMENT (SECTION - A) (objective type question)|29 Videos
  • HYDROGEN

    AAKASH INSTITUTE ENGLISH|Exercise Assignment (Section-J)|5 Videos
  • HYDROCARBONS

    AAKASH INSTITUTE ENGLISH|Exercise Assignment(Section - C) (Previous Years Questions)|60 Videos
  • M0ck test 26

    AAKASH INSTITUTE ENGLISH|Exercise EXAMPLE|43 Videos

Similar Questions

Explore conceptually related problems

Calculate the strength of 10 volume solution of hydrogen peroxide.

Calculate the strength in g//L of 10 volume solution of hydrogen peroxide at 273 K and 1 bar pressure. [Report your answer divided by 10]

Hydrogen peroxide is

The aqeous solution of hydrogen peroxide:

Calculate the strength of a 40 volume hydrogen peroxide solution in gL^(-1)

Strength of 10 volume hydrogen peroxide solution means

20 volume hydrogen peroxide means

How is a dilute solution of hydrogen peroxide concentrated?

Calculate the normality of 18 volume hydrogen peroxide solution .

Calculate the volume strength of a hydrogen peroxide solution containing 60.7 g L^(-1) of H_(2)O_(2) .

AAKASH INSTITUTE ENGLISH-HYDROGEN-EXAMPLES
  1. Discuss the resemblance of hydrogen with halogens.

    Text Solution

    |

  2. Which isotope of hydrogen is radioactive in nature?

    Text Solution

    |

  3. Which isotope of hydrogen contains equal number of protons and neutron...

    Text Solution

    |

  4. Comment on the reaction of dihydrogen with fluorine.

    Text Solution

    |

  5. Explain the use of hydrogen in the formation of vegetable fats.

    Text Solution

    |

  6. Which class of covalent hydrides are considered as lewis acids?

    Text Solution

    |

  7. Association of molecules in water is due to:

    Text Solution

    |

  8. Describe the nature of ionic hydrides.

    Text Solution

    |

  9. Why do alcohol (a covalent compound) dissolves in water (ionic)?

    Text Solution

    |

  10. Which properties of hydrogen as responsible for moderation of the clim...

    Text Solution

    |

  11. Compare the density of ice and water.

    Text Solution

    |

  12. Does water gets oxidised in the process of photosynthesis?

    Text Solution

    |

  13. What type of water forms scum with soap?

    Text Solution

    |

  14. Write the reaction that takes place on adding lime to water containing...

    Text Solution

    |

  15. Explain with the help of reactions that how heavy water is used in the...

    Text Solution

    |

  16. What is calgon?

    Text Solution

    |

  17. Calculate the strength of 30 volume solution of hydrogen peroxide.

    Text Solution

    |

  18. What is the percentage strength of a solution of 100 volume H(2)O(2)?

    Text Solution

    |

  19. Why H(2)O(2) is kept away from dust?

    Text Solution

    |

  20. PbS(s)+4H(2)O(2)(aq)toPbSO(4)(s)+4H(2)O(l) In the above reaction, H(...

    Text Solution

    |