Home
Class 11
CHEMISTRY
If the equilibrium constant of the react...

If the equilibrium constant of the reaction
`2HI(g)hArrH_(2)(g)+I_(2)(g)` is `0.25`, find the equilibrium constant of the reaction.
`(1)/(2)H_(2)+(1)/(2)I_(2)hArrHI(g)`

Text Solution

AI Generated Solution

The correct Answer is:
To solve the problem, we need to find the equilibrium constant for the reaction: \[ \frac{1}{2} H_2 + \frac{1}{2} I_2 \rightleftharpoons HI(g) \] given that the equilibrium constant for the reaction: \[ 2 HI(g) \rightleftharpoons H_2(g) + I_2(g) \] is \( K_c = 0.25 \). ### Step-by-Step Solution: 1. **Write the given equilibrium reaction and its constant:** The first reaction is: \[ 2 HI(g) \rightleftharpoons H_2(g) + I_2(g) \] The equilibrium constant for this reaction is given as: \[ K_{c1} = 0.25 \] 2. **Reverse the reaction:** When we reverse the reaction, we get: \[ H_2(g) + I_2(g) \rightleftharpoons 2 HI(g) \] The equilibrium constant for the reversed reaction is the reciprocal of the original: \[ K_{c1}' = \frac{1}{K_{c1}} = \frac{1}{0.25} = 4 \] 3. **Multiply the reversed reaction by 1/2:** Now, we need to find the equilibrium constant for the reaction: \[ \frac{1}{2} H_2(g) + \frac{1}{2} I_2(g) \rightleftharpoons HI(g) \] To obtain this reaction from the reversed reaction, we multiply the entire equation by \( \frac{1}{2} \): \[ \frac{1}{2} H_2(g) + \frac{1}{2} I_2(g) \rightleftharpoons HI(g) \] 4. **Relate the equilibrium constant:** When we multiply a reaction by a factor, the equilibrium constant is raised to the power of that factor. Since we multiplied the reaction by \( \frac{1}{2} \), we have: \[ K_{c2} = (K_{c1}')^{\frac{1}{2}} = (4)^{\frac{1}{2}} = 2 \] 5. **Final answer:** Therefore, the equilibrium constant for the reaction: \[ \frac{1}{2} H_2 + \frac{1}{2} I_2 \rightleftharpoons HI(g) \] is: \[ K_{c2} = 2 \]

To solve the problem, we need to find the equilibrium constant for the reaction: \[ \frac{1}{2} H_2 + \frac{1}{2} I_2 \rightleftharpoons HI(g) \] given that the equilibrium constant for the reaction: ...
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    RESONANCE ENGLISH|Exercise Exercise-2 (Part-3)|33 Videos
  • CHEMICAL EQUILIBRIUM

    RESONANCE ENGLISH|Exercise Exercise-2 (Part-4)|6 Videos
  • CHEMICAL EQUILIBRIUM

    RESONANCE ENGLISH|Exercise Exercise-2 (Part-1)|28 Videos
  • CHEMICAL BONDING

    RESONANCE ENGLISH|Exercise ORGANIC CHEMISTRY(Fundamental Concept )|6 Videos
  • D & F-BLOCK ELEMENTS & THEIR IMPORTANT COMPOUNDS

    RESONANCE ENGLISH|Exercise Match the column|1 Videos

Similar Questions

Explore conceptually related problems

If the equilibrium constant of the reaction 2HIhArr H_(2)+I_(2) is 0.25, then the equilibrium constant for the reaction, H_(2)(g)+I_(2)(g)hArr 2HI(g) would be

Write the equilibrium constant of the reaction C(s)+H_(2)O(g)hArrCO(g)+H_(2)(g)

The value of equilibrium constant of the reaction. HI(g)hArr(1)/(2)H_2(g)+(1)/(2)I_2(g) is 8.0 The equilibrium constant of the reaction. H_2(g)+I_2(g)hArr2HI(g) will be

The equilibrium constant for the reaction H_(2)O(g)+CO(g)hArrH_(2)(g)+CO_(2)(g) is 0.44 at 1660 K. The equilibrium constant for the reaction 2H_(2)(g)+2CO_(2)(g)hArr 2CO(g)+2H_(2)O(g) at 1660 K is equal to

The equilibrium constant (K_(c)) for the reaction 2HCl(g)hArrH_(2)(g)+Cl_(2)(g) is 4xx10^(-34) at 25^(@)C .what is the equilibrium constant for the reaction ? (1)/(2)H_(2)(g)+(1)/(2)Cl_(2)(g)hArrHCl(g)

For the reaction, 2HI(g) rarr H_(2)(g) + I_(2) (g) - Q KJ , the equilibrium constant depends upon

The equilibrium constant at 717 K for the reaction: H_(2(g))+I_(2(g))lArr2HI_((g)) is 50. The equilibrium constant for the reaction: 2HI_(2(g))lArrH_(2(g))+I_(2(g)) is

The equilibrium constant for the given reaction is 100. N_(2)(g)+2O_(2)(g) hArr 2NO_(2)(g) What is the equilibrium constant for the reaction ? NO_(2)(g) hArr 1//2 N_(2)(g) +O_(2)(g)

The equilibrium constant (K_(c)) for the reaction 2HCl(g)hArrH_(2)(g)+Cl_(2)(g) is 4xx10^(-34) at 25^(@)C .what is the equilibrium constant K_p for the reaction ?

The equilibrium constant of the reaction SO_(2)(g) + 1//2O_(2)(g)hArrSO_(3)(g) is 4xx10^(-3)atm^(-1//2) . The equilibrium constant of the reaction 2SO_(3)(g)hArr2SO_(2)(g) + O_(2)(g) would be:

RESONANCE ENGLISH-CHEMICAL EQUILIBRIUM-Exercise-2 (Part-2)
  1. A(G)+B(g)hArrC(g)+D(g) Above equilibrium is established by taking A&...

    Text Solution

    |

  2. In a reversible reaction, the forward reaction was 3 times faster than...

    Text Solution

    |

  3. If the equilibrium constant of the reaction 2HI(g)hArrH(2)(g)+I(2)(g...

    Text Solution

    |

  4. In an experiment starting with 1 mol C(2)H(5)OH, 1 mol CH(3)COOH, and ...

    Text Solution

    |

  5. For the reaction: N(2)O(5)(g)rarr2NO(2)(g)+0.5O(2)(g) Calculate t...

    Text Solution

    |

  6. Consider the equilibrium Ni(s)+4CO(g)hArrNi(CO)(4)(g), K(p)=0.125atm...

    Text Solution

    |

  7. For the equilibrium system FeO(s)CO(g)hArrFe(s)+CO(2)(g)(Exothermic)...

    Text Solution

    |

  8. Consider the reaction, 2CI(2)(g)+2H(2)O(g)hArr4HCI(g)+P(2)(g) DeltaH^(...

    Text Solution

    |

  9. For given simultaneous reaction : X(s)hArrA(g)+B(s)+C(g) K(P(1))=500...

    Text Solution

    |

  10. If a mixture 0.4 mole H2 and 0.2 mole Br2 is heated at 700 K at equili...

    Text Solution

    |

  11. 2 mole of PCI(5) were heated in a 5 litre vessel. It dissociated. 80% ...

    Text Solution

    |

  12. A(2)(g) and B(2)(g) having partial pressures 60mm of Hg & 45mm of Hg r...

    Text Solution

    |

  13. When C(2)H(5)OH and CH(3)COOH are mixed in equivalent proportion, equi...

    Text Solution

    |

  14. In reaction N(2)O(4)(g)rarr 2NO(2)(g), The observed molecular weight "...

    Text Solution

    |

  15. The vapour density of N(2)O(4) at a certain temperature is 30. Calcula...

    Text Solution

    |

  16. Solid Ammonium carbamate dissociates as: NH(2)COONH(4)(s)hArr2NH(3)(...

    Text Solution

    |

  17. If 50% of CO(2) converts to CO at the following equilibrium: (1)/(2)...

    Text Solution

    |

  18. Two solids A and D dissociates into gaseous products as follows C(s)...

    Text Solution

    |

  19. Consider (i) C(s)+O(2)hArrCO(2)(g) K(P(2)=(7)/(8) (ii) 2C(s)+O(2)h...

    Text Solution

    |

  20. Two solid compounds A "and" C dissociate into gaseous product at tempe...

    Text Solution

    |