If `3-` hexanone is reacted with `NaBH_(4)` followed by hydrolysis with `D_(2)O` , the product will be `:`

Options

A. `CH_(3)-CH_(2)-underset(underset(OD)|)(C)H-CH_(2)-CH_(2)-CH_(3)`
B. `CH_(3)-CH_(2)-underset(underset(OD)|)overset(overset(D)|)(C)-CH_(2)-CH_(3)`
C. `CH_(3)-CH_(2)-underset(underset(OH)|)overset(overset(D)|)(C)-CH_(2)-CH_(2)-CH_(3)`
D. `CH_(3)-CH_(2)-underset(underset(OH)|)(C)H-CH_(2)-CH_(2)-CH_(3)`

Explanation

To solve the question regarding the reaction of 3-hexanone with sodium borohydride followed by hydrolysis with D2O, we can break it down into a series of steps:

### Step-by-Step Solution:

1. **Identify the Structure of 3-Hexanone**:
- 3-Hexanone is a ketone with the molecular formula C6H12O. Its structure can be represented as:
```
CH3-CH2-CO-CH2-CH2-CH3
```
- The carbonyl (C=O) group is located at the third carbon.

2. **Reaction with Sodium Borohydride (NaBH4)**:
- Sodium borohydride is a reducing agent that reduces ketones to alcohols.
- When 3-hexanone reacts with NaBH4, the carbonyl group (C=O) is reduced to a hydroxyl group (–OH).
- The product after this reduction will be:
```
CH3-CH2-CHOH-CH2-CH2-CH3
```
- This compound is 3-hexanol.

3. **Hydrolysis with D2O**:
- Hydrolysis with D2O involves the exchange of the hydrogen atom in the hydroxyl group (–OH) with deuterium (D).
- Therefore, the hydroxyl group in 3-hexanol will be converted to a deuterated hydroxyl group (–OD).
- The final product after hydrolysis will be:
```
CH3-CH2-CH(OD)-CH2-CH2-CH3
```
- This can also be written as:
```
CH3-CH2-CH(OD)-CH2-CH2-CH3
```

4. **Final Product**:
- The final product of the reaction is 3-hexanol where the hydroxyl group is replaced with deuterium, resulting in:
```
CH3-CH2-CH(OD)-CH2-CH2-CH3
```

### Final Answer:
The product will be 3-hexanol with deuterium, represented as:
```
CH3-CH2-CH(OD)-CH2-CH2-CH3
```