Home
Class 11
CHEMISTRY
SO(3)(g)hArrSO(2)(g)+(1)/(2)O(2)(g) If...

`SO_(3)(g)hArrSO_(2)(g)+(1)/(2)O_(2)(g)`
If observed vapour density of mixture at equilibrium is `35` then find out value of `alpha`

A

`0.28`

B

`0.38`

C

`0.48`

D

`0.58`

Text Solution

AI Generated Solution

The correct Answer is:
To solve the problem, we need to find the degree of dissociation (\( \alpha \)) of the reaction: \[ \text{SO}_3(g) \rightleftharpoons \text{SO}_2(g) + \frac{1}{2} \text{O}_2(g) \] Given that the observed vapor density of the mixture at equilibrium is 35, we can use the formula for degree of dissociation: \[ \alpha = \frac{D - d}{(n - 1) \cdot d} \] Where: - \( D \) = Molar mass of the reactant (SO3) / 2 - \( d \) = Vapor density at equilibrium - \( n \) = Number of moles of products formed from 1 mole of reactant ### Step 1: Calculate the molar mass of SO3 The molar mass of SO3 can be calculated as follows: - Molar mass of Sulfur (S) = 32 g/mol - Molar mass of Oxygen (O) = 16 g/mol Thus, the molar mass of SO3 is: \[ \text{Molar mass of SO}_3 = 32 + (16 \times 3) = 32 + 48 = 80 \text{ g/mol} \] ### Step 2: Calculate \( D \) Now, we can calculate \( D \): \[ D = \frac{\text{Molar mass of SO}_3}{2} = \frac{80}{2} = 40 \] ### Step 3: Identify \( d \) The vapor density at equilibrium is given as: \[ d = 35 \] ### Step 4: Calculate \( n \) Next, we need to find \( n \). For the reaction, starting with 1 mole of SO3, the products formed are: - 1 mole of SO2 - 0.5 mole of O2 Thus, the total number of moles of products is: \[ n = 1 + 0.5 = 1.5 \] ### Step 5: Substitute values into the equation for \( \alpha \) Now we can substitute the values into the equation for \( \alpha \): \[ \alpha = \frac{D - d}{(n - 1) \cdot d} = \frac{40 - 35}{(1.5 - 1) \cdot 35} \] Calculating the numerator: \[ 40 - 35 = 5 \] Calculating the denominator: \[ (1.5 - 1) \cdot 35 = 0.5 \cdot 35 = 17.5 \] Now substituting these values back into the equation for \( \alpha \): \[ \alpha = \frac{5}{17.5} = 0.2857 \approx 0.28 \] ### Final Answer Thus, the value of \( \alpha \) is approximately: \[ \alpha \approx 0.28 \]

To solve the problem, we need to find the degree of dissociation (\( \alpha \)) of the reaction: \[ \text{SO}_3(g) \rightleftharpoons \text{SO}_2(g) + \frac{1}{2} \text{O}_2(g) \] Given that the observed vapor density of the mixture at equilibrium is 35, we can use the formula for degree of dissociation: \[ \alpha = \frac{D - d}{(n - 1) \cdot d} ...
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    RESONANCE ENGLISH|Exercise Exercise-2 (Part-1)|28 Videos
  • CHEMICAL EQUILIBRIUM

    RESONANCE ENGLISH|Exercise Exercise-2 (Part-2)|22 Videos
  • CHEMICAL EQUILIBRIUM

    RESONANCE ENGLISH|Exercise Exercise-1 (Part-1)|38 Videos
  • CHEMICAL BONDING

    RESONANCE ENGLISH|Exercise ORGANIC CHEMISTRY(Fundamental Concept )|6 Videos
  • D & F-BLOCK ELEMENTS & THEIR IMPORTANT COMPOUNDS

    RESONANCE ENGLISH|Exercise Match the column|1 Videos

Similar Questions

Explore conceptually related problems

At 627^(@) C and one atmosphere SO_(3) is is partially dissociated into SO_(2) and O_(2) by SO_(3(g)) hArr SO_(2(g)) + (1)/(2) O_(2(g)). The density of the equilibrium mixture is 0.925 g/litre. What is the degree of dissociation ?

At 627^(@)C and 1 atm SO_(3) is partially dissociated into SO_(2) and O_(2) by the reaction SO_(3)(g)hArrSO_(2)(g)+1//2O_(2)(g) The density of the equilibrium mixture is 0.925 g L^(-1) . What is the degree of dissociation?

At 727^(@)C and 1.2 atm of total equilibrium pressure, SO_(3) is partially dissociated into SO_(2) and O_(2) as: SO_(3)(g)hArrSO_(2)(g)+(1)/(2)O_(2)(g) The density of equilibrium mixture is 0.9 g//L . The degree of dissociation is:, [Use R=0.08 atm L mol^(-1) K^(-1)]

Before equilibrium is set-up the chemical reaction N_(2)O_(4)(g) hArr 2NO_(2)(g) , vapour density d of the gaseous mixture was measured. If D is the theoretica value of vapour density, variation of alpha with D//d is given by the graph below. What is value D//d at point A ?

SO_(3)(g)+CO(g)hArrSO_(2)(g)+CO_(2)(g) Which of the following activity can reduce the equilibrium concentration of CO to half?

For the reaction N_(2)O(g) hArr 2NO_(2)(g). DeltaH=57.49kJ // mole, the vapour density of equilibrium mixture ……………………….. with increase of temperature.

CaCO_(3)(s)hArrCaO(s)+CO_(2)(g) CO_(2)(g)hArrCO(g)+(1)/(2)O_(2)(g) For above simultaneous equilibrium if CO_(2) is added from out side at equilibrium then:

For the equlibrium SO_(3)(g)hArrSO_(2)(g)+1/2O(2)(g) the molar mass at equlibrium was observed to be 60. then the degree of dissociation of SO_(3) would be

Consider the following equilibrium 2AB(g)hArrA_(2)(g)+B_(2)(g) The vapour density of the equilibrium mixture does not depend upon

Consider the following hypothetical equilibrium 2B(g)hArrB_(2)(g) If d is observed vapour density and D is theoretical vapour density, then degree of association (alpha) will be

RESONANCE ENGLISH-CHEMICAL EQUILIBRIUM-Exercise-1 (Part-2)
  1. The vapour density of fully dissociated NH(4)Cl would be

    Text Solution

    |

  2. The degree of dissociation is 0.5 at 800K and 2 atm for the gaseous r...

    Text Solution

    |

  3. SO(3)(g)hArrSO(2)(g)+(1)/(2)O(2)(g) If observed vapour density of mi...

    Text Solution

    |

  4. What is the minimum mass of CaCO3(s), below which it decomposes comple...

    Text Solution

    |

  5. If 50% of CO(2) converts to CO at the following equilibrium: (1)/(2)...

    Text Solution

    |

  6. Solid ammonium carbamate dissociate to give ammonia and carbon dioxide...

    Text Solution

    |

  7. For NH(4)HS(s)hArrNH(3)(g)+H(2)S(g) reaction started only with NH(4)HS...

    Text Solution

    |

  8. Consider the decomposition of solid NH(4)HS in a flask containing NH(3...

    Text Solution

    |

  9. What is the relative humidity of air at 1 bar pressure and 313K temper...

    Text Solution

    |

  10. For the equilibrium CuSO(4)xx5H(2)O(s)hArrCuSO(4)xx3H(2)O(s) + 2H(2)O(...

    Text Solution

    |

  11. (a) CuSO(4).5H(2)O(s)hArrCuSO(4).3H(2)O(s)+2H(2)O(g) K(p)=4xx10^(-4)at...

    Text Solution

    |

  12. For the equilibrium CuSO(2).5H(2)O(s)hArrCuSO(4).3H(2)O(s)+2H(2)O(g) ...

    Text Solution

    |

  13. CuSO(4).5H(2)O(s)hArrCuSO(4). 3H(2)O(s)+2H(2)O(g), K(p)=4xx10^(-4)atm^...

    Text Solution

    |

  14. The correct relationship between free energy change in a reaction and ...

    Text Solution

    |

  15. For the reaction, H(2)(g)+I(2)(g)hArr 2HI(g), K(c)^(@)=66.9 at 350^(@)...

    Text Solution

    |

  16. The equilibrium constants for the reaction Br(2)hArr 2Br at 500 K an...

    Text Solution

    |

  17. An exothermic reaction is represented by the graph :

    Text Solution

    |

  18. An endothermic reaction is represented by the graph:

    Text Solution

    |

  19. The value of DeltaG^(@) for a reaction in aqueous phase having K(c)=1,...

    Text Solution

    |

  20. The effect of temperature on equilibrium constant is expressed as(T(2)...

    Text Solution

    |