Which of the following is not the metamer of `CH_3CH_2-underset(CH_3)underset(|)N-CH_2CH_2CH_2CH_3`

Options

A. `CH_(3)-underset(CH_3)underset(|)N-CH_(2)CH_(2)CH_(2)CH_(2)CH_(3)`
B. `CH_(3)-underset(H)underset(|)N-CH_(2)-underset(CH_3)underset(|)(CH)-CH_(2)CH_(2)CH_(3)`
C.
D. `CH_(3)CH_(2)CH_(2)-underset(CH_3)underset(|)(N)-CH_(2)CH_(2)CH_(3)`

Answer

To determine which of the given compounds is not a metamer of the compound `CH3CH2-(CH3)-N-CH2CH2CH2CH3`, we first need to understand what a metamer is. Metamers are structural isomers that have the same functional group but differ in the arrangement of alkyl groups around that functional group.

### Step-by-Step Solution:

1. **Identify the Given Compound**:
The compound in question is `CH3CH2-(CH3)-N-CH2CH2CH2CH3`. This compound has a nitrogen atom (N) bonded to two different alkyl groups: an ethyl group (from `CH3CH2-`) and a butyl group (`-CH2CH2CH2CH3`).

2. **Understand the Concept of Metamers**:
Metamers have the same functional group (in this case, the amine group -N-) but differ in the alkyl groups attached to that functional group. Therefore, we need to check the options provided to see which one does not have different alkyl groups attached to the nitrogen.

3. **Evaluate Each Option**:
- **Option 1**: `CH3-N(CH3)-C5H11` (where C5H11 is a pentyl group)
- Here, we have two CH3 groups and a pentyl group. Since two of the groups are identical (CH3), this is not a metamer.
- **Option 2**: `CH3-CH2-N(CH3)-CH2CH2CH3`
- This has one CH3 and one ethyl group, which is different from the original compound. This is a metamer.
- **Option 3**: `CH3-N(CH3)-CH2-CH2-CH3`
- This has two CH3 groups and a butyl group. Since two of the groups are identical (CH3), this is not a metamer.
- **Option 4**: `CH3-CH2-N(CH3)-CH2-CH2`
- This has one CH3 and one ethyl group, which is different from the original compound. This is a metamer.

4. **Conclusion**:
The options that are not metamers of the given compound are:
- Option 1 (two identical CH3 groups)
- Option 3 (two identical CH3 groups)

Thus, the answer to the question is that **Option 1 and Option 3 are not metamers** of the given compound.

### Final Answer:
**Option 1 and Option 3 are not metamers of the given compound.**